A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1091 |
| PubChem ID | 6741 |
| Hormone name | Methylprednisolone |
| Description | A PREDNISOLONE derivative with similar anti-inflammatory action. |
| Synonyms | Methylprednisolone Medrol Medrone Metilbetasone Promacortine Dopomedrol Metrisone Medesone Mesopren Metastab |
| Molecular weight | 374.47 |
| Molecular formula | C22H30O5 |
| IUPAC Name | (6S,8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-17-(2-hydroxyacetyl)-6,10,13-trimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
| Canonical smiles | CC1CC2C3CCC(C3(CC(C2C4(C1=CC(=O)C=C4)C)O)C)(C(=O)CO)O |
| Isomeric smiles | C[C@H]1C[C@H]2[C@@H]3CC[C@@]([C@]3(C[C@@H]([C@@H]2[C@@]4(C1=CC(=O)C=C4)C)O)C)(C(=O)CO)O
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | D00407 |
| HMDB ID | N/A |
| Melting Point | 232.5(EXP) |
| Log P | 1.82(EST) |
| Water Solubility | 120(EXP) at 25C |
| DrugBank ID | DB00959 |
| Drugpedia | wiki |
| Receptor | P04150 Detail in HMRbase |
| Comments | |
| References | Pubchem |