A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1092 |
| PubChem ID | 16923 |
| Hormone name | Methylprednisolone Hemisuccinate |
| Description | A water-soluble ester of METHYLPREDNISOLONE used for cardiac, allergic, and hypoxic emergencies. |
| Synonyms | Solumedrol Methylprednisolone Hemisuccinate Urbason-Soluble A-Methapred Solu-Medrol Methylprednisolone succinate |
| Molecular weight | 474.54 |
| Molecular formula | C26H34O8 |
| IUPAC Name | 4-[2-[(6S,8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-6,10,13-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethoxy] -4-oxobutanoic acid |
| Canonical smiles | CC1CC2C3CCC(C3(CC(C2C4(C1=CC(=O)C=C4)C)O)C)(C(=O)COC(=O)CCC(=O)O)O |
| Isomeric smiles | C[C@H]1C[C@H]2[C@@H]3CC[C@@]([C@]3(C[C@@H]([C@@H]2[C@@]4(C1=CC(=O)C=C4)C)O)C)(C(=O)COC(=O)CCC(=O)O)O
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | D05000 |
| HMDB ID | N/A |
| Melting Point | N/A |
| Log P | N/A |
| Water Solubility | N/A |
| DrugBank ID | DB00959 |
| Drugpedia | wiki |
| Receptor | P04150 Detail in HMRbase |
| Comments | |
| References | Pubchem |