A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1095 |
| PubChem ID | 9904 |
| Hormone name | Nandrolone |
| Description | C18 steroid with androgenic and anabolic properties. It is generally prepared from alkyl ethers of ESTRADIOL to resemble TESTOSTERONE but less one carbon at the 19 position. |
| Synonyms | 19-Nortestosterone Nandrolone Nortestosterone Nortestonate Menidrabol Oestrenolon Nandrolon Norandrostenolon Nortestosteronum Norandrostenolone |
| Molecular weight | 274.4 |
| Molecular formula | C18H26O2 |
| IUPAC Name | (8R,9S,10R,13S,14S,17S)-17-hydroxy-13-methyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
| Canonical smiles | CC12CCC3C(C1CCC2O)CCC4=CC(=O)CCC34 |
| Isomeric smiles | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2O)CCC4=CC(=O)CC[C@H]34
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C07254 |
| HMDB ID | HMDB02725 |
| Melting Point | N/A |
| Log P | 2.62(EXP) |
| Water Solubility | 323(EST) at 25C |
| DrugBank ID | DB00984 |
| Drugpedia | wiki |
| Receptor | P10275 Detail in HMRbase |
| Comments | |
| References | Pubchem |