A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1098 |
| PubChem ID | 5878 |
| Hormone name | Oxandrolone |
| Description | A synthetic hormone with anabolic and androgenic properties. |
| Synonyms | Oxandrolone Oxandrin Protivar Provitar Vasorome Lonavar Anavar Ossandrolone Oxandrin (TN) Oxandrolonum |
| Molecular weight | 306.44 |
| Molecular formula | C19H30O3 |
| IUPAC Name | (1S,3aS,3bR,5aS,9aS,9bS,11aS)-1-hydroxy-1,9a,11a-trimethyl-2,3,3a,3b,4,5,5a,6,9,9b,10,11-dodecahydroindeno[7,6-h]isochromen-7-one |
| Canonical smiles | CC12CCC3C(C1CCC2(C)O)CCC4C3(COC(=O)C4)C |
| Isomeric smiles | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@]2(C)O)CC[C@@H]4[C@@]3(COC(=O)C4)C
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C07346 D00462 |
| HMDB ID | N/A |
| Melting Point | 236.5(EXP) |
| Log P | 2.58(EST) |
| Water Solubility | N/A |
| DrugBank ID | DB00621 |
| Drugpedia | wiki |
| Receptor | P10275 Detail in HMRbase |
| Comments | |
| References | Pubchem |