A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1109 |
| PubChem ID | 9046 |
| Hormone name | Quinestrol |
| Description | The 3-cyclopentyl ether of ETHINYL ESTRADIOL. After gastrointestinal absorption, it is stored in ADIPOSE TISSUE, slowly released, and metabolized principally to the parent compound. It has been used in ESTROGEN REPLACEMENT THERAPY. (From AMA Drug Evaluations Annual, 1992, p1011) |
| Synonyms | Quinestrol Estrovis Estrovister Plestrovis Eston Qui-Lea Quinestrolo |
| Molecular weight | 364.52 |
| Molecular formula | C25H32O2 |
| IUPAC Name | (8R,9S,13S,14S,17R)-3-cyclopentyloxy-17-ethynyl-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol |
| Canonical smiles | CC12CCC3C(C1CCC2(C#C)O)CCC4=C3C=CC(=C4)OC5CCCC5 |
| Isomeric smiles | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@]2(C#C)O)CCC4=C3C=CC(=C4)OC5CCCC5
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C07619 D00576   |
| HMDB ID | N/A |
| Melting Point | 107.5(EXP) |
| Log P | 6.460 (EST) |
| Water Solubility | N/A |
| DrugBank ID | DB04575 |
| Drugpedia | wiki |
| Receptor | P03372 Detail in HMRbase |
| Comments | |
| References | Pubchem |