A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1112 |
| PubChem ID | 25249 |
| Hormone name | Stanozolol |
| Description | A synthetic steroid that has anabolic and androgenic properties. (From Martindale, The Extra Pharmacopoeia, 30th ed, p1194) |
| Synonyms | Stanozolol Androstanazole Winstrol Stromba Androstanazol Strombaject Tevabolin Winstroid Estazol |
| Molecular weight | 328.49 |
| Molecular formula | C21H32N2O |
| IUPAC Name | N/A |
| Canonical smiles | CC12CCC3C(C1CCC2(C)O)CCC4C3(CC5=C(C4)NN=C5)C |
| Isomeric smiles | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@]2(C)O)CC[C@@H]4[C@@]3(CC5=C(C4)NN=C5)C
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C07311 D00444 |
| HMDB ID | N/A |
| Melting Point | N/A |
| Log P | N/A |
| Water Solubility | N/A |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | P15207 Detail in HMRbase |
| Comments | |
| References | Pubchem |