A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1113 |
| PubChem ID | 6013 |
| Hormone name | Testosterone |
| Description | A potent androgenic steroid and major product secreted by the LEYDIG CELLS of the TESTIS. Its production is stimulated by LUTEINIZING HORMONE from the PITUITARY GLAND. In turn, testosterone exerts feedback control of the pituitary LH and FSH secretion. Depending on the tissues, testosterone can be further converted to DIHYDROTESTOSTERONE or ESTRADIOL. |
| Synonyms | Testosterone Testosteron Androderm Oreton Methyltestosterone Mertestate Testoderm Androlin trans-Testosterone Testex |
| Molecular weight | 288.42 |
| Molecular formula | C19H28O2 |
| IUPAC Name | (8R,9S,10R,13S,14S,17S)-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| Canonical smiles | CC12CCC3C(C1CCC2O)CCC4=CC(=O)CCC34C |
| Isomeric smiles | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2O)CCC4=CC(=O)CC[C@]34C
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | 1I37  1I38  1I9J  1J96  1Q13  1VPO  2Q7I  2Q7J  2Q7K  2Q7L  1AFS   |
| KEGG ID | C00535 D00075   |
| HMDB ID | HMDB00234 |
| Melting Point | 155(EXP) |
| Log P | 3.32(EXP) |
| Water Solubility | 23.4(EXP) at 25C |
| DrugBank ID | DB00624 |
| Drugpedia | wiki |
| Receptor | P10275 Detail in HMRbase |
| Comments | |
| References | Pubchem,HMDB |