A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1182 |
| PubChem ID | 65076 |
| Hormone name | Cholesteryl sulfate |
| Description | component of human seminal plasma and spermatozoa; RN given refers to (3beta)-isomer |
| Synonyms | Cholesterol sulfate Cholesteryl sulfate Chol-sulf Cholesterol 3-sulfate Y5-Cholesten-3beta-yl sulfate Cholest-5-en-3beta-ol sulfate |
| Molecular weight | 466.72 |
| Molecular formula | C27H46O4S |
| IUPAC Name | [(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] hydrog en sulfate |
| Canonical smiles | CC(C)CCCC(C)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)OS(=O)(=O)O)C)C |
| Isomeric smiles | CC(C)CCC[C@@H](C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)OS(=O)(=O)O)C)C
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | 1S0X 2HKA |
| KEGG ID | N/A |
| HMDB ID | HMDB00653 |
| Melting Point | N/A |
| Log P | N/A |
| Water Solubility | N/A |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | P35398 Detail in HMRbase |
| Comments | |
| References | HMDB |