A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1232 |
| PubChem ID | 5816 |
| Hormone name | Epinephrine |
| Description | The active sympathomimetic hormone from the adrenal medulla in most species. It stimulates both the alpha- and beta- adrenergic systems, causes systemic vasoconstriction and gastrointestinal relaxation, stimulates the heart, and dilates bronchi and cerebral vessels. It is used in asthma and cardiac failure and to delay absorption of local anesthetics. |
| Synonyms | epinephrine l-Adrenaline adrenaline Adrenalin Levoepinephrine L-epinephrine Adrenalinum Epinephran Epipen l-Epirenamine |
| Molecular weight | 183.2 |
| Molecular formula | C9H13NO3 |
| IUPAC Name | 4-[(1R)-1-hydroxy-2-methylaminoethyl]benzene-1,2-diol |
| Canonical smiles | CNCC(C1=CC(=C(C=C1)O)O)O |
| Isomeric smiles | CNC[C@@H](C1=CC(=C(C=C1)O)O)O
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C00788 D00095   |
| HMDB ID | HMDB00068 |
| Melting Point | 211.5(EXP) |
| Log P | -1.37E+00(EXP) |
| Water Solubility | 180(EXP) |
| DrugBank ID | DB00668 |
| Drugpedia | wiki |
| Receptor | P08588 Detail in HMRbase P35348 Detail in HMRbase P07550 Detail in HMRbase |
| Comments | |
| References | Endonet |