A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1243 |
| PubChem ID | 57363 |
| Hormone name | Finasteride |
| Description | An orally active TESTOSTERONE 5-ALPHA-REDUCTASE inhibitor. It is used as a surgical alternative for treatment of benign prostatic hyperplasia. |
| Synonyms | finasteride Propecia Proscar Chibro-Proscar Finastid Prostide Finpecia Eucoprost Propeshia Andozac |
| Molecular weight | 372.54 |
| Molecular formula | C23H36N2O2 |
| IUPAC Name | (1S,3aS,3bS,5aR,9aR,9bS,11aS)-N-tert-butyl-9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinoline-1-carboxamide |
| Canonical smiles | CC12CCC3C(C1CCC2C(=O)NC(C)(C)C)CCC4C3(C=CC(=O)N4)C |
| Isomeric smiles | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2C(=O)NC(C)(C)C)CC[C@@H]4[C@@]3(C=CC(=O)N4)C
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | D00321   |
| HMDB ID | HMDB01984 |
| Melting Point | 3.03(EXP) |
| Log P | 11.7(EST) at 25C |
| Water Solubility | N/A |
| DrugBank ID | DB01216 |
| Drugpedia | wiki |
| Receptor | P10275 Detail in HMRbase |
| Comments | |
| References | HMDB |