A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1290 |
| PubChem ID | 439260 |
| Hormone name | Norepinephrine |
| Description | Precursor of epinephrine that is secreted by the adrenal medulla and is a widespread central and autonomic neurotransmitter. Norepinephrine is the principal transmitter of most postganglionic sympathetic fibers and of the diffuse projection system in the brain arising from the locus ceruleus. It is also found in plants and is used pharmacologically as a sympathomimetic. |
| Synonyms | norepinephrine noradrenaline L-Noradrenaline Arterenol Levarterenol L-Norepinephrine L-arterenol Levophed Adrenor Aktamin |
| Molecular weight | 169.18 |
| Molecular formula | C8H11NO3 |
| IUPAC Name | 4-[(1R)-2-amino-1-hydroxyethyl]benzene-1,2-diol |
| Canonical smiles | C1=CC(=C(C=C1C(CN)O)O)O |
| Isomeric smiles | C1=CC(=C(C=C1[C@H](CN)O)O)O
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C00547 D00076   |
| HMDB ID | HMDB00216 |
| Melting Point | N/A |
| Log P | N/A |
| Water Solubility | N/A |
| DrugBank ID | DB00368 |
| Drugpedia | wiki |
| Receptor | P08588 Detail in HMRbase P08913 Detail in HMRbase P18825 Detail in HMRbase P35348 Detail in HMRbase P18089 Detail in HMRbase P35368 Detail in HMRbase P07550 Detail in HMRbase P25100 Detail in HMRbase P13945 Detail in HMRbase |
| Comments | |
| References | Endonet |