A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1346 |
| PubChem ID | 5283122 |
| Hormone name | 12-keto-10,11,14,15-tetrahydro-LTB4 |
| Description | |
| Synonyms | 12-keto-10,11,14,15-tetrahydro-LTB4 5S-hydroxy-12-keto-6Z,8E-eicosadienoic acid |
| Molecular weight | 338.48 |
| Molecular formula | C20H34O4 |
| IUPAC Name | (5S,6Z,8E)-5-hydroxy-12-oxoicosa-6,8-dienoic acid |
| Canonical smiles | CCCCCCCCC(=O)CCC=CC=CC(CCCC(=O)O)O |
| Isomeric smiles | CCCCCCCCC(=O)CCC=CC=C/[C@H](CCCC(=O)O)O
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | N/A |
| HMDB ID | HMDB02995 |
| Melting Point | N/A |
| Log P | N/A |
| Water Solubility | N/A |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | Q15722 Detail in HMRbase Q9Y271 Detail in HMRbase Q9NPC1 Detail in HMRbase |
| Comments | |
| References | Endonet |