A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1348 |
| PubChem ID | 5283132 |
| Hormone name | 14,15-dehydro-LTB4 |
| Description | |
| Synonyms | 14,15-dehydro-LTB4 5S,12R-dihydroxy-6Z,8E,10E-eicosatriene-14-ynoic acid |
| Molecular weight | 333.45 |
| Molecular formula | C20H30O4 |
| IUPAC Name | (5S,6Z,8E,10E,12R)-5,12-dihydroxyicosa-6,8,10-trien-14-ynoic acid |
| Canonical smiles | CCCCCC#CCC(C=CC=CC=CC(CCCC(=O)O)O)O |
| Isomeric smiles | CCCCCC#CC[C@H](C=CC=CC=C/[C@H](CCCC(=O)O)O)O
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | N/A |
| HMDB ID | N/A |
| Melting Point | N/A |
| Log P | N/A |
| Water Solubility | N/A |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | Q15722 Detail in HMRbase Q9Y271 Detail in HMRbase Q9NPC1 Detail in HMRbase |
| Comments | |
| References | Endonet |