A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1359 |
| PubChem ID | 5280914 |
| Hormone name | Lipoxin A4 |
| Description | structure given in first source; a role in ASPIRIN antiinflammatory activity |
| Synonyms | lipoxin A4 5S,6R-LipoxinA4 LXA4 |
| Molecular weight | 352.47 |
| Molecular formula | C20H32O5 |
| IUPAC Name | (5S,6R,7E,9E,11Z,13E,15S)-5,6,15-trihydroxyicosa-7,9,11,13-tetraenoicacid |
| Canonical smiles | CCCCCC(C=CC=CC=CC=CC(C(CCCC(=O)O)O)O)O |
| Isomeric smiles | CCCCC[C@@H](C=CC=C/C=C/C=C/[C@H]([C@H](CCCC(=O)O)O)O)O
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C06314 |
| HMDB ID | HMDB04385 |
| Melting Point | N/A |
| Log P | N/A |
| Water Solubility | N/A |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | Q9Y271 Detail in HMRbase P25090 Detail in HMRbase |
| Comments | |
| References | Endonet |