A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1360 |
| PubChem ID | 5280915 |
| Hormone name | LipoxinB4 |
| Description | structure in first source |
| Synonyms | LipoxinB4 Lipoxin B LXB4 5,14,15-Thet 5S,14R,15S-trihydroxy-6E,8Z,10E,12E-Eicosatetraenoic acid |
| Molecular weight | 352.47 |
| Molecular formula | C20H32O5 |
| IUPAC Name | (5S,6E,8Z,10E,12E,14R,15S)-5,14,15-trihydroxyicosa-6,8,10,12-tetraenoicacid |
| Canonical smiles | CCCCCC(C(C=CC=CC=CC=CC(CCCC(=O)O)O)O)O |
| Isomeric smiles | CCCCC[C@@H]([C@@H](C=CC=CC=C/C=C/[C@H](CCCC(=O)O)O)O)O
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C06315 |
| HMDB ID | HMDB05082 |
| Melting Point | N/A |
| Log P | N/A |
| Water Solubility | N/A |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | Q9Y271 Detail in HMRbase |
| Comments | |
| References | Endonet |