A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1363 |
| PubChem ID | 5311211 |
| Hormone name | 15-Deoxy-PGJ2 |
| Description | 15-deoxy-PGJ2 is also available; check for double bonds (indicated by delta) at 12 and 14 positions |
| Synonyms | 15-Deoxy-PGJ2 PGJ2 delta12,14-PGJ 2 15d-PGJ2 15-deoxy-delta-12,14-PGJ2 15-Deoxy-delta12,14-PGJ2 AIDS039990 15-Deoxy .delta.12,14PGJ2 |
| Molecular weight | 316.43 |
| Molecular formula | C20H28O3 |
| IUPAC Name | (Z)-7-[(1S,5E)-5-[(E)-oct-2-enylidene]-4-oxo-1-cyclopent-2-enyl]hept-5-enoic acid |
| Canonical smiles | CCCCCC=CC=C1C(C=CC1=O)CC=CCCCC(=O)O |
| Isomeric smiles | CCCCCC=CC=C1/[C@H](C=CC1=O)CC=C/CCCC(=O)O
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C14717 |
| HMDB ID | HMDB05079 |
| Melting Point | N/A |
| Log P | N/A |
| Water Solubility | N/A |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | P37231 Detail in HMRbase |
| Comments | |
| References | Endonet |