A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1004 |
| PubChem ID | 6238 |
| Hormone name | 17-alpha-Hydroxyprogesterone |
| Description | A metabolite of PROGESTERONE with a hydroxyl group at the 17-alpha position. It serves as an intermediate in the biosynthesis of HYDROCORTISONE and GONADAL STEROID HORMONES. |
| Synonyms | Prodix Prodox Gestageno gador hydroxyprogesterone Proluton Setaderm Oxiprogesteronum 17-Hydroxyprogesterone 17-alpha-Hydroxyprogesterone Idrossiprogesterone |
| Molecular weight | 330.46 |
| Molecular formula | C21H30O3 |
| IUPAC Name | (8R,9S,10R,13S,14S,17R)-17-acetyl-17-hydroxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| Canonical smiles | CC(=O)C1(CCC2C1(CCC3C2CCC4=CC(=O)CCC34C)C)O |
| Isomeric smiles | CC(=O)[C@]1(CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CCC4=CC(=O)CC[C@]34C)C)O
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C01176 |
| HMDB ID | HMDB00374 |
| Melting Point | 222-223(EXP) |
| Log P | 3.17(EXP) |
| Water Solubility | 6.48(EXP) at 27C |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | P06401 Detail in HMRbase Q8NG42 Detail in HMRbase Q8NG43 Detail in HMRbase Q8NG44 Detail in HMRbase Q8TDS3 Detail in HMRbase |
| Comments | |
| References | Pubchem,HMDB |