A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1034 |
| PubChem ID | 5281707 |
| Hormone name | Coumestrol |
| Description | A daidzein derivative occurring naturally in forage crops which has some estrogenic activity. |
| Synonyms | Cumoestrol Cumostrol Chrysanthin 7,12-Dihydroxycoumestan |
| Molecular weight | 268.22 |
| Molecular formula | C15H8O5 |
| IUPAC Name | 3,9-dihydroxy-[1]benzoxolo[3,2-c]chromen-6-one |
| Canonical smiles | C1=CC2=C(C=C1O)OC3=C2C(=O)OC4=C3C=CC(=C4)O |
| Isomeric smiles | N/A
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C10205 |
| HMDB ID | HMDB02326 |
| Melting Point | 385(EXP)) |
| Log P | 1.57(EST) |
| Water Solubility | N/A |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | P03372 Detail in HMRbase Q92731 Detail in HMRbase Q16095 Detail in HMRbase Q16405 Detail in HMRbase Q9H1Z6 Detail in HMRbase Q9H2M1 Detail in HMRbase Q9H2M2 Detail in HMRbase Q9UBT1 Detail in HMRbase Q9UE35 Detail in HMRbase |
| Comments | |
| References | Pubchem |