A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1046 |
| PubChem ID | 448537 |
| Hormone name | Diethylstilbestrol |
| Description | A synthetic nonsteroidal estrogen used in the treatment of menopausal and postmenopausal disorders. It was also used formerly as a growth promoter in animals. According to the Fourth Annual Report on Carcinogens (NTP 85-002, 1985), diethylstilbestrol has been listed as a known carcinogen. (Merck, 11th ed) |
| Synonyms | Diethylstilbestrol Stilbestrol Agostilben Stilbetin Vagestrol Stilboestroform Menostilbeen Oestrogenine Oestromenin Oestromensyl |
| Molecular weight | 268.35 |
| Molecular formula | C18H20O2 |
| IUPAC Name | 4-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]phenol |
| Canonical smiles | CCC(=C(CC)C1=CC=C(C=C1)O)C2=CC=C(C=C2)O |
| Isomeric smiles | CC/C(=C(/CC)C1=CC=C(C=C1)O)/C2=CC=C(C=C2)O
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C07620 D00577 |
| HMDB ID | N/A |
| Melting Point | 170.5(EXP) |
| Log P | 5.07(EXP) |
| Water Solubility | 12(EXP) at 25C |
| DrugBank ID | DB00255 |
| Drugpedia | wiki |
| Receptor | P03372 Detail in HMRbase P62510 Detail in HMRbase P62508 Detail in HMRbase |
| Comments | |
| References | Pubchem |