A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1057 |
| PubChem ID | 444865 |
| Hormone name | Equilenin |
| Description | An estrogenic steroid produced by HORSES. It has a total of five double bonds in the A- and B-ring. High concentration of equilenin is found in the URINE of pregnant mares. |
| Synonyms | Equilenin solution Ambap7299 3-Hydroxy-1,3,5(10),6,8-estrapentaen-17-one |
| Molecular weight | 266.33 |
| Molecular formula | C18H18O2 |
| IUPAC Name | (13S,14S)-3-hydroxy-13-methyl-12,14,15,16-tetrahydro-11H-cyclopenta[a]phenanthren-17-one |
| Canonical smiles | CC12CCC3=C(C1CCC2=O)C=CC4=C3C=CC(=C4)O |
| Isomeric smiles | C[C@]12CCC3=C([C@@H]1CCC2=O)C=CC4=C3C=CC(=C4)O
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | 1GS3 1OGX 1CQS 1OH0 1OGZ 1OHO 1W6Y 1QJG |
| KEGG ID | C14303 |
| HMDB ID | N/A |
| Melting Point | N/A |
| Log P | N/A |
| Water Solubility | N/A |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | P03372 Detail in HMRbase Q92731 Detail in HMRbase Q9H2M1 Detail in HMRbase Q9H2M2 Detail in HMRbase |
| Comments | |
| References | Pubchem |