A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1058 |
| PubChem ID | 3247 |
| Hormone name | Equilin |
| Description | An estrogenic steroid produced by HORSES. It has a total of four double bonds in the A- and B-ring. High concentration of euilin is found in the URINE of pregnant mares. |
| Synonyms | Equilin Dihydroequilenin 7-Dehydroestrone |
| Molecular weight | 268.35 |
| Molecular formula | C18H20O2 |
| IUPAC Name | 3-hydroxy-13-methyl-9,11,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-one |
| Canonical smiles | CC12CCC3C(=CCC4=C3C=CC(=C4)O)C1CCC2=O |
| Isomeric smiles | N/A
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C14392 D04041 |
| HMDB ID | N/A |
| Melting Point | 239(EXP) |
| Log P | 3.35(EST) |
| Water Solubility | 1.41(EXP) at 25C |
| DrugBank ID | DB02187 |
| Drugpedia | wiki |
| Receptor | P03372 Detail in HMRbase Q92731 Detail in HMRbase Q9H2M1 Detail in HMRbase Q9H2M2 Detail in HMRbase |
| Comments | |
| References | Pubchem |