A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1064 |
| PubChem ID | 5991 |
| Hormone name | Ethinyl Estradiol |
| Description | A semisynthetic alkylated ESTRADIOL with a 17-alpha-ethinyl substitution. It has high estrogenic potency when administered orally, and is often used as the estrogenic component in ORAL CONTRACEPTIVES. |
| Synonyms | Ethinyl Estradiol Ethynylestradiol Estinyl Etinoestryl Etistradiol Ethinoral Eticyclin Eticyclol Etinestrol |
| Molecular weight | 296.4 |
| Molecular formula | C20H24O2 |
| IUPAC Name | (8R,9S,13S,14S,17R)-17-ethynyl-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
| Canonical smiles | CC12CCC3C(C1CCC2(C#C)O)CCC4=C3C=CC(=C4)O |
| Isomeric smiles | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@]2(C#C)O)CCC4=C3C=CC(=C4)O
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C07534 D00554 |
| HMDB ID | N/A |
| Melting Point | 183(EXP) |
| Log P | 3.67(EXP) |
| Water Solubility | 11.3(EXP) at 27C |
| DrugBank ID | DB00977 |
| Drugpedia | wiki |
| Receptor | P03372 Detail in HMRbase O75469 Detail in HMRbase |
| Comments | |
| References | Pubchem |