A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1072 |
| PubChem ID | 6446 |
| Hormone name | Fluoxymesterone |
| Description | An anabolic steroid that has been used in the treatment of male HYPOGONADISM, delayed puberty in males, and in the treatment of breast neoplasms in women. |
| Synonyms | Fluoxymesterone Androfluorene Androfluorone Halotestin Androsterolo Fluosterone Oralsterone Fluotestin |
| Molecular weight | 336.44 |
| Molecular formula | C20H29FO3 |
| IUPAC Name | (8S,9R,10S,11S,13S,14S,17S)-9-fluoro-11,17-dihydroxy-10,13,17-trimethyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| Canonical smiles | CC12CCC(=O)C=C1CCC3C2(C(CC4(C3CCC4(C)O)C)O)F |
| Isomeric smiles | C[C@]12CCC(=O)C=C1CC[C@@H]3[C@@]2([C@H](C[C@]4([C@H]3CC[C@]4(C)O)C)O)F
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | D00327 |
| HMDB ID | N/A |
| Melting Point | 270(EXP) |
| Log P | 2.38(EXP) |
| Water Solubility | 67.5(EST) at 25C |
| DrugBank ID | DB01185 |
| Drugpedia | wiki |
| Receptor | P03372 Detail in HMRbase P10275 Detail in HMRbase |
| Comments | |
| References | Pubchem |