A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1330 |
| PubChem ID | 541103 |
| Hormone name | Medroxyprogesterone |
| Description | (6 alpha)-17-Hydroxy-6-methylpregn-4-ene-3,20-dione. A synthetic progestational hormone used in veterinary practice as an estrus regulator. |
| Synonyms | Medroxyprogesterone Pregn-4-ene-3,20-dione, 17-hydroxy-6-methyl-, (6.alpha.)- |
| Molecular weight | 344.49 |
| Molecular formula | C22H32O3 |
| IUPAC Name | 17-acetyl-17-hydroxy-6,10,13-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| Canonical smiles | CC1CC2C(CCC3(C2CCC3(C(=O)C)O)C)C4(C1=CC(=O)CC4)C |
| Isomeric smiles | N/A
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C07119 |
| HMDB ID | HMDB01939 |
| Melting Point | N/A |
| Log P | N/A |
| Water Solubility | N/A |
| DrugBank ID | DB00603 |
| Drugpedia | wiki |
| Receptor | P03372 Detail in HMRbase P06401 Detail in HMRbase |
| Comments | |
| References | HMDB |