A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1351 |
| PubChem ID | 5280492 |
| Hormone name | Leukotriene B4 |
| Description | The major metabolite in neutrophil polymorphonuclear leukocytes. It stimulates polymorphonuclear cell function (degranulation, formation of oxygen-centered free radicals, arachidonic acid release, and metabolism). (From Dictionary of Prostaglandins and Related Compounds, 1990) |
| Synonyms | LEUKOTRIENE B4 LTB4 Leukotriene- B4 5,12-Dihete 5,12-Hete |
| Molecular weight | 336.47 |
| Molecular formula | C20H32O4 |
| IUPAC Name | (5S,6Z,8E,10E,12R,14Z)-5,12-dihydroxyicosa-6,8,10,14-tetraenoic acid |
| Canonical smiles | CCCCCC=CCC(C=CC=CC=CC(CCCC(=O)O)O)O |
| Isomeric smiles | CCCCCC=C/C[C@H](C=CC=CC=C/[C@H](CCCC(=O)O)O)O
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C02165 |
| HMDB ID | HMDB01085 |
| Melting Point | N/A |
| Log P | N/A |
| Water Solubility | N/A |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | Q15722 Detail in HMRbase Q9Y271 Detail in HMRbase Q9NPC1 Detail in HMRbase |
| Comments | |
| References | Endonet |