A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1352 |
| PubChem ID | 5283126 |
| Hormone name | LTB4 dimethyl amide |
| Description | |
| Synonyms | LTB4 dimethyl amide N,N-dimethyl-5S,12R-dihydroxy-6Z,8E,10E,14Z-eicosatetraen-1-amide |
| Molecular weight | 363.53 |
| Molecular formula | C22H37NO3 |
| IUPAC Name | (5S,6Z,8E,10E,12R,14Z)-5,12-dihydroxy-N,N-dimethylicosa-6,8,10,14-tetraenamide |
| Canonical smiles | CCCCCC=CCC(C=CC=CC=CC(CCCC(=O)N(C)C)O)O |
| Isomeric smiles | CCCCCC=C/C[C@H](C=CC=CC=C/[C@H](CCCC(=O)N(C)C)O)O
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | N/A |
| HMDB ID | HMDB05085 |
| Melting Point | N/A |
| Log P | N/A |
| Water Solubility | N/A |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | Q15722 Detail in HMRbase Q9Y271 Detail in HMRbase Q9NPC1 Detail in HMRbase |
| Comments | |
| References | Endonet |