A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1365 |
| PubChem ID | 5280723 |
| Hormone name | Prostaglandin E1 |
| Description | prostaglandin oligomeric derivative; RN given refers to cpd with unknown MF; inhibits several lipolytic and proteolytic enzymes |
| Synonyms | alprostadil Prostaglandin E1 Befar Prostandin Prostavasin Caverject Topiglan Femprox Sugiran Viridal |
| Molecular weight | 354.48 |
| Molecular formula | C20H34O5 |
| IUPAC Name | 7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoic acid |
| Canonical smiles | CCCCCC(C=CC1C(CC(=O)C1CCCCCCC(=O)O)O)O |
| Isomeric smiles | CCCCC[C@@H](C=C[C@H]1[C@@H](CC(=O)[C@@H]1CCCCCCC(=O)O)O)O
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C04741 D00180 |
| HMDB ID | N/A |
| Melting Point | N/A |
| Log P | N/A |
| Water Solubility | N/A |
| DrugBank ID | DB00770 |
| Drugpedia | wiki |
| Receptor | P34995 Detail in HMRbase P43116 Detail in HMRbase P43115 Detail in HMRbase P35408 Detail in HMRbase P43119 Detail in HMRbase |
| Comments | |
| References | Endonet |