A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1369 |
| PubChem ID | 5997 |
| Hormone name | Cholesterol |
| Description | The principal sterol of all higher animals, distributed in body tissues, especially the brain and spinal cord, and in animal fats and oils. |
| Synonyms | cholesterol Cholesterin Cordulan Dusoline Dusoran Cholesterine Hydrocerin Provitamin D |
| Molecular weight | 386.65 |
| Molecular formula | C27H46O |
| IUPAC Name | (3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| Canonical smiles | CC(C)CCCC(C)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)O)C)C |
| Isomeric smiles | CC(C)CCC[C@@H](C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)O)C)C
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | 1LRI 1N83 1ZHY 2RH1 3D4S |
| KEGG ID | C00187 |
| HMDB ID | HMDB00067 |
| Melting Point | 148.5(EXP) |
| Log P | 8.74(EST) |
| Water Solubility | 0.095(EXP) |
| DrugBank ID | DB04540 |
| Drugpedia | wiki |
| Receptor | P35398 Detail in HMRbase P51448 Detail in HMRbase |
| Comments | |
| References | Endonet |