Details of SAPdb entry with Sequence DFN |
| Primary information | |
|---|---|
| SAPdb ID | 1158, |
| PMID | 12095997 |
| Peptide Name | hCT(15-17) |
| Peptide sequence | DFN |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | Electron Microscopy |
| Solvent | 0.02M NaCl + 0.01M Tris |
| Method | Stock solutions (100 mg/ml) of the peptide fragments were suspended in 0.02 M NaCl, 0.01 M Tris, pH 7.2, aged for 2 days |
| Temperature | pH 7.2 |
| Incubation Time | 48 hours |
| Year | 2002 |
| Self assembly | No |
| Type of Self assembly | No self-assembly |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| None | |
| NA | |
| None | |
| N[C@@H](CC(=O)O)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CC(=O)N)C=O | |