Details of SAPdb entry with Sequence DFY |
| Primary information | |
|---|---|
| SAPdb ID | 1101, |
| PMID | 26014441 |
| Peptide Name | Peptide 2b |
| Peptide sequence | DFY |
| N-Terminal Modification | Free |
| C-Terminal Modification | Amidation |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | TEM (Transmission Electron Microscopy), FTIR and DOSY NMR |
| Solvent | Sodium phosphate buffer (100mM ) |
| Method | 20 mM of aspartame (DF-OMe) and 40 mM of the amino acid amide (Tyr-NH2) were dissolved in 1 ml of 100mM sodium phosphate buffer pH 8 in the presence of 1 mg of chymotrypsin. The mixture was gently vortexed for 30s and sonicated for 60s in order to obtain a homogenous solution. gealtion was observed. |
| Temperature | 8 |
| Incubation Time | 24 hours |
| Year | 2015 |
| Self assembly | Yes |
| Type of Self assembly | Spherical Nano structures |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanosphere | |
| NA | |
| None | |
| N[C@@H](CC(=O)O)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N | |