Details of SAPdb entry with Sequence FFK |
| Primary information | |
|---|---|
| SAPdb ID | 1070, |
| PMID | 23871602 |
| Peptide Name | FFK |
| Peptide sequence | FFK |
| N-Terminal Modification | Acetylation |
| C-Terminal Modification | Amidation |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | AFM (Atomic Force Microscopy), TEM (Transmission Electron Microscopy), DLS (Dynamic Light Scattering) and CD (Circular Dichroism spectroscopy) |
| Solvent | Water and HFIP (9.5:0.5, v/v) |
| Method | For preparation of FFK solution, the mixture of water and HFIP (9.5:0.5, v/v) was used to dissolve the peptide at 1.0 mg/mL with sonication for 30 min. final solution pH was around 5–6. The peptide solutions were incubated for at least one week |
| Conc | 1mg/ml |
| Temperature | pH 5-6 |
| Incubation Time | 2 weeks |
| Year | 2013 |
| Self assembly | Yes |
| Type of Self assembly | Long (amyloid like) tubular structure |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanotube | |
| 6 | |
| None | |
| CC(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCC[NH3])C(=O)N | |
| Primary information | |
| SAPdb ID | 1169, |
| PMID | 21121607 |
| Peptide Name | Hydrogelator 1 |
| Peptide sequence | FFK |
| N-Terminal Modification | Napthyl |
| C-Terminal Modification | Olsalazine |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | Conjugate |
| Conjugate partner | Olsalazine |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Water |
| Method | 6.0 mg of peptide dissolved in 0.50 mL of water to give a clear solution, after which a change in pH to 5.0 resulted in a viscous suspension. Ultrasound sonication of the suspension for 2 min or an increase of its temperature to ∼60 °C followed by cooling to ambient temperature afforded a transparent, yellow gel. |
| Conc | 1.2 wt% |
| Temperature | pH 5 |
| Temperature | Heating at 60°C, cooling at RT |
| Year | 2010 |
| Self assembly | Yes |
| Type of Self assembly | Hydrogel containing Nanofibers |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable | |
| Hydrogel | |
| 11 | |
| None | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1170, |
| PMID | 21121607 |
| Peptide Name | 1 |
| Peptide sequence | FFK |
| N-Terminal Modification | Acetylation |
| C-Terminal Modification | Olsalazine |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | Conjugate |
| Conjugate partner | Olsalazine |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Water |
| Method | 6.0 mg of peptide dissolved in 0.50 mL of water to give a clear solution, after which a change in pH to 5.0 resulted in a viscous suspension. Ultrasound sonication of the suspension for 2 min or an increase of its temperature to ∼60 °C followed by cooling to ambient temperature afforded a transparent, yellow gel. |
| Conc | 1.2 wt% |
| Temperature | pH 5 |
| Temperature | Heating at 60°C, cooling at RT |
| Year | 2010 |
| Self assembly | No |
| Type of Self assembly | No hydrogel formation |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable | |
| None | |
| NA | |
| None | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1171, |
| PMID | 21121607 |
| Peptide Name | Hydrogelator 1 |
| Peptide sequence | ffk |
| N-Terminal Modification | Napthyl |
| C-Terminal Modification | Olsalazine |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | Conjugate |
| Conjugate partner | Olsalazine |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Water |
| Method | 6.0 mg of peptide dissolved in 0.50 mL of water to give a clear solution, after which a change in pH to 5.0 resulted in a viscous suspension. Ultrasound sonication of the suspension for 2 min or an increase of its temperature to ∼60 °C followed by cooling to ambient temperature afforded a transparent, yellow gel. |
| Conc | 1.2 wt% |
| Temperature | pH 5 |
| Temperature | Heating at 80°C, cooling at RT |
| Year | 2010 |
| Self assembly | Yes |
| Type of Self assembly | Hydrogel containing Nanofibers |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| High biostabilty even on the treatment of proteinase K for 48 hours | |
| Hydrogel | |
| 13 | |
| None | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1175, |
| PMID | 23240879 |
| Peptide Name | Nap-FFK |
| Peptide sequence | FFK |
| N-Terminal Modification | Napthalene |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | Cryo - TEM (Transmission Electron Microscopy) |
| Solvent | PBS (Phosphate Buffer Saline) |
| Method | 1.0 mg of each peptide and equal molar of sodium carbonate to the peptide were first suspended in PBS buffer (pH = 7.4); the sodium carbonate was used to neutralize the terminal carboxylic acid of peptides. The suspensions were then heated to 80°C to form clear solutions. The gels would form after cooling back to room temperature within 3 min. |
| Conc | < 4% wt |
| Temperature | pH 7.4 |
| Temperature | Heating at 80°C, cooling at RT |
| Incubation Time | 3 minutes |
| Year | 2012 |
| Self assembly | Yes |
| Type of Self assembly | Hydrogel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Hydrogel | |
| NA | |
| None | |
| N.A. | |