Welcome to Sequence Card of Peptide
Details of SAPdb entry with Sequence IVW |
| Primary information | |
|---|---|
| SAPdb ID | 1165, |
| PMID | 22016623 |
| Peptide Name | Ac-IW3 |
| Peptide sequence | IVW |
| N-Terminal Modification | Acetylation |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | FE - SEM (Field Emission Scanning Electron Microscopy) |
| Solvent | Water |
| Method | Peptide dissolved in water by vortexing and left at room temperature to form hydrogel. Depending upon peptide concentration and sequence peptide form gel within minutes, hours or days. |
| Conc | 5mg/ml |
| Temperature | Room temperature |
| Incubation Time | 72 hours |
| Year | 2011 |
| Self assembly | Yes |
| Type of Self assembly | Unstable Hyrogel or small aggregate structure |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Unstable | |
| Hydrogel | |
| NA | |
| None | |
| CC(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C=O | |