Details of SAPdb entry with Sequence YYD |
| Primary information | |
|---|---|
| SAPdb ID | 1126, |
| PMID | 25010703 |
| Peptide Name | Ac-YYD |
| Peptide sequence | YYD |
| N-Terminal Modification | Acetylation |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | FE - SEM (Field Emission Scanning Electron Microscopy) |
| Solvent | water |
| Method | The peptides were dissolved by vortexing in deionized water. For proper self-asSEM (Scanning Electron Microscopy)bly, all The tripeptide samples kept for 24-48 hours |
| Conc | 40mg/ml |
| Temperature | 22°C |
| Incubation Time | 24-48hours |
| Year | 2014 |
| Self assembly | Yes |
| Type of Self assembly | Fibrillar aggregates |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanofibers | |
| 50 | |
| None | |
| CC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CC(=O)O)CO | |