Details of SAPdb entry with Sequence fDI |
| Primary information | |
|---|---|
| SAPdb ID | 1104, |
| PMID | 25891849 |
| Peptide Name | D- phenylalanine-L-phenylalanine-L-isoleucine |
| Peptide sequence | fDI |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | SEM (Scanning Electron Microscopy), TEM (Transmission Electron Microscopy) and CD (Circular Dichroism spectroscopy) |
| Solvent | Phosphate buffer (30mM,) |
| Method | 12.5 mg of peptide was dissolved in 1 ml phosphate buffer solution (pH 8) (30 mM). The solubility was enhanced by heating up to 80 °C. After cooling down to room temperature precipitate formed. |
| Conc | 12.5mg/ml |
| Temperature | pH8 |
| Temperature | Room temperature |
| Year | 2012 |
| Self assembly | Yes |
| Type of Self assembly | Highly ordered fibres |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanofibers | |
| NA | |
| None | |
| N[C@H](Cc1ccccc1)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H]([C@@H](C)CC)C=O | |
| Primary information | |
| SAPdb ID | 1105, |
| PMID | 25891849 |
| Peptide Name | D- phenylalanine-L-phenylalanine-L-isoleucine |
| Peptide sequence | fDI |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | SEM (Scanning Electron Microscopy), TEM (Transmission Electron Microscopy) and CD (Circular Dichroism spectroscopy) |
| Solvent | Phosphate buffer (30mM,) |
| Method | 12.5 mg of peptide was dissolved in 1 ml phosphate buffer solution (pH 8) (30 mM). The solubility was enhanced by heating up to 80 °C. Sample was given ultrasonic treatment for 60 seconds and gel formed. |
| Conc | 12.5mg/ml |
| Temperature | pH8 |
| Temperature | Room temperature |
| Year | 2012 |
| Self assembly | Yes |
| Type of Self assembly | Hydrogel consists of highly ordred fibers |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| With ultrasonic waves treatment | |
| NA | |
| Hydrogel | |
| 100000 | |
| None | |
| N[C@H](Cc1ccccc1)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H]([C@@H](C)CC)C=O | |