Details of SAPdb entry with Sequence fFD |
| Primary information | |
|---|---|
| SAPdb ID | 1102, |
| PMID | 25891849 |
| Peptide Name | D-phenylalanine-L-phenylalanine-L-aspartic acid |
| Peptide sequence | fFD |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | SEM (Scanning Electron Microscopy), TEM (Transmission Electron Microscopy) |
| Solvent | Methanol (25 mM) |
| Method | 10 mg of peptide was fully dissolved in 1 ml methanol (25 mM) by heating up to 50°C for 3 minutes. Gel formed on cooling down to room temperature. |
| Conc | 10mg/ml |
| Temperature | Room temperature |
| Year | 2012 |
| Self assembly | Yes |
| Type of Self assembly | Disorder Short fibres |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Others | |
| NA | |
| None | |
| N[C@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CC(=O)O)C=O | |
| Primary information | |
| SAPdb ID | 1103, |
| PMID | 25891849 |
| Peptide Name | D-phenylalanine-L-phenylalanine-L-aspartic acid |
| Peptide sequence | fFD |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | SEM (Scanning Electron Microscopy), TEM (Transmission Electron Microscopy) |
| Solvent | Methanol (25 mM) |
| Method | 10 mg of peptide was fully dissolved in 1 ml methanol (25 mM) by heating up to 50°C for 3 minutes. Sample was given ultrasonic treatment for 30 seconds and gel formed. |
| Conc | 10mg/ml |
| Temperature | Room temperature |
| Year | 2012 |
| Self assembly | Yes |
| Type of Self assembly | Organogel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| With ultrasonic waves treatment | |
| NA | |
| Organogel | |
| NA | |
| None | |
| N[C@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CC(=O)O)C=O | |