Details of SAPdb entry with Sequence nal-nal |
| Primary information | |
|---|---|
| SAPdb ID | 1260, |
| PMID | 19496552 |
| Peptide Name | 2 Nal dipeptide or dinapthylalanine |
| Peptide sequence | nal-nal |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | nal=D-2-napthylalanine |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | AFM (Atomic Force Microscopy |
| Solvent | 1,1,1,3,3,3-hexafluoro-2-propanol (HFIP)/water |
| Method | Peptide was dissolved in HFIP (1,1,1,3,3,3-hexafluoro-2-propanol) at 100mg/ml conc., solution is further diluted with water at pH 6 to make final concenteration 2mg/ml. Peptide solutions were placed onto freshly cleaved mica substrates and and dried under nitrogen gas. |
| Conc | 2mg/ml |
| Temperature | 6 |
| Temperature | Room temperature |
| Year | 2009 |
| Self assembly | Yes |
| Type of Self assembly | Nanotube |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable at 120°C | |
| Nanotube | |
| 15 | |
| AA | |
| N[C@@H](Cc1ccc2c(c1)cccc2)C(=O)N[C@@H](Cc1ccc2c(c1)cccc2)C=O | |