Details of SAPdb entry with Sequence vFF |
| Primary information | |
|---|---|
| SAPdb ID | 1074, |
| PMID | 22159641 |
| Peptide Name | D-VFF |
| Peptide sequence | vFF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | Cryo - TEM (Transmission Electron Microscopy), AFM (Atomic Force Microscopy), CD (Circular Dichroism spectroscopy) and FTIR (Fourier Transform Infrared) Spectroscopy (Fourier Transform Infrared) Spectroscopy |
| Solvent | 0.1M Phosphate buffer |
| Method | Peptide was dissolved in a 0.1 M sodium phosphate solution at pH 12, while subsequent dilution to final physiological pH at 7.4 triigered the formation of hydrogel at room temperature within 24 hours. |
| Temperature | pH 7.4 |
| Temperature | 25°C |
| Incubation Time | 24 hours |
| Year | 2012 |
| Self assembly | Yes |
| Type of Self assembly | Long Nanotape and hydrogel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Hydrogel | |
| NA | |
| None | |
| N[C@H](C(C)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1076, |
| PMID | 22159641 |
| Peptide Name | VFF |
| Peptide sequence | VFF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | Cryo - TEM (Transmission Electron Microscopy), AFM (Atomic Force Microscopy), CD (Circular Dichroism spectroscopy) and FTIR (Fourier Transform Infrared) Spectroscopy (Fourier Transform Infrared) Spectroscopy |
| Solvent | 0.1M Phosphate buffer |
| Method | Peptide wast dissolved in a 0.1 M sodium phosphate solution at pH 12, while subsequent dilution to final physiological pH at 7.4 triigered the formation of hydrogel at room temperature within 24 hours. |
| Temperature | pH 7.4 |
| Year | 2012 |
| Self assembly | No |
| Type of Self assembly | No self assembled structure |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| None | |
| NA | |
| None | |
| N[C@@H](C(C)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |