Details of SAPdb entry with Sequence AV |
| Primary information | |
|---|---|
| SAPdb ID | 1238, |
| PMID | 20695592 |
| Peptide Name | Dipeptide 4 |
| Peptide sequence | AV |
| N-Terminal Modification | Napthalene |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Conjugate |
| Conjugate partner | Napthalene |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Deionized water + 0.1 M Sodium hydroxide + glucono-δ-lactone (GdL) |
| Method | Stock solutions of dipeptide-conjugates at a concentration of (0.5 wt%) were prepared and equimolar NaOH (0.1M ) added to it. These were then diluted with pH 10 water to a number of concentrations. To adjust the pH, for each dipeptide-conjugate solution and required quantity of GdL is added to solution to ensure final pH between 3.2 -3.6. Samples were left to stand at least 24 h. |
| Conc | 0.5 wt% |
| Temperature | 3.4 +/- 0.2. |
| Temperature | Room temperature |
| Incubation Time | 24 hours |
| Year | 2010 |
| Self assembly | Yes |
| Type of Self assembly | Transparent Gel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Hydrogel | |
| NA | |
| AV | |
| N[C@@H](Cc1ccc2c(c1)cccc2)C(=O)N[C@@H](C(C)C)CO | |
| Primary information | |
| SAPdb ID | 1244, |
| PMID | 20695592 |
| Peptide Name | Dipeptide 10 |
| Peptide sequence | AV |
| N-Terminal Modification | Bromo-Napthalene or napthalene derivative |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Conjugate |
| Conjugate partner | Bromo-Napthalene |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Deionized water + 0.1 M Sodium hydroxide + glucono-δ-lactone (GdL) |
| Method | Stock solutions of dipeptide-conjugates at a concentration of (0.5 wt%) were prepared and equimolar NaOH (0.1M ) added to it. These were then diluted with pH 10 water to a number of concentrations. To adjust the pH, for each dipeptide-conjugate solution and required quantity of GdL is added to solution to ensure final pH between 3.2 -3.6. Samples were left to stand at least 24 h. |
| Conc | 0.5 wt% |
| Temperature | 3.4 +/- 0.2. |
| Temperature | Room temperature |
| Incubation Time | 24 hours |
| Year | 2010 |
| Self assembly | Yes |
| Type of Self assembly | Transparent Gel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Hydrogel | |
| NA | |
| AV | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1250, |
| PMID | 20695592 |
| Peptide Name | Dipeptide 17 |
| Peptide sequence | AV |
| N-Terminal Modification | Cyano-Napthalene or napthalene derivative |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Conjugate |
| Conjugate partner | Nitrile-Napthalene |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Deionized water + 0.1 M Sodium hydroxide + glucono-δ-lactone (GdL) |
| Method | Stock solutions of dipeptide-conjugates at a concentration of (0.5 wt%) were prepared and equimolar NaOH (0.1M ) added to it. These were then diluted with pH 10 water to a number of concentrations. To adjust the pH, for each dipeptide-conjugate solution and required quantity of GdL is added to solution to ensure final pH between 3.2 -3.6. Samples were left to stand at least 24 h. |
| Conc | 0.5 wt% |
| Temperature | 3.4 +/- 0.2. |
| Temperature | Room temperature |
| Incubation Time | 24 hours |
| Year | 2010 |
| Self assembly | Yes |
| Type of Self assembly | Turbid Gel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Others | |
| NA | |
| AV | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1273, |
| PMID | 19921840 |
| Peptide Name | Naphthalene-alanylvaline |
| Peptide sequence | AV |
| N-Terminal Modification | Napthalene |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Conjugate |
| Conjugate partner | Napthalene |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Water + glucono-δ-lactone (GdL) |
| Method | 25 mg of dipeptide derivative was suspended in 5ml deionized water . An equimolar quantity of NaOH (0.1 M, aq) was added, and the solution was gently stirred for 30 min until a clear solutionwas formed. The pH of this solution was measured to be 10.7. Glucono-δ-lactone (GdL) was addedaccording to the requirements of final pH, and finally the samples were kept for 24 h to form hydrogel. |
| Conc | 0.5 wt% |
| Temperature | pH 3.1 - 5 |
| Temperature | Room temperature |
| Incubation Time | 24 hours |
| Year | 2009 |
| Self assembly | Yes |
| Type of Self assembly | Hydrogel (Consist of Nanofibres) |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable under acidic conditions | |
| Hydrogel | |
| NA | |
| AV | |
| N[C@@H](Cc1ccc2c(c1)cccc2)C(=O)N[C@@H](C(C)C)C=O | |
| Primary information | |
| SAPdb ID | 1283, |
| PMID | 22890605 |
| Peptide Name | BrNapAV |
| Peptide sequence | AV |
| N-Terminal Modification | Bromine-napthol |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Conjugate |
| Conjugate partner | Bromine-napthol |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | Water + glucono-δ-lactone (GdL) + PAG (photoacid generator) |
| Method | A 0.5 wt% stock solution of dipeptide at pH 9 – 10 prepaed by adding 1 equivalent of sodium hydroxide solution 0.1 M solution) with stirring to dissolve, 0.1 M HCl added to lower the pH of solution o 5.4. To form gels, 2 mL of stock solution was placed in a 7 mL Sterilin cup for 14 hours and UV light was irradiated from a 40 W Spectroline X-series UV lamp (wavelength 254 nm) . |
| Conc | 5mg/ml |
| Temperature | 5.4 |
| Temperature | Room temperature |
| Incubation Time | 14 hours |
| Year | 2012 |
| Self assembly | Yes |
| Type of Self assembly | Slightly turbid gel (Nanofibers) |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Hydrogel | |
| 20 | |
| AV | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1386, |
| PMID | 24611271 |
| Peptide Name | (LMWG)2 |
| Peptide sequence | AV |
| N-Terminal Modification | 2-[(6-bromonaphthalen-2-yl)oxy]acetic acid |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | SEM (Scanning Electron Microscopy) and SANS (small angle neutron scattering) |
| Solvent | Water + 1.0M NaOH + 8.7 mg/ml GdL (glucono-d-lactone) + CO2 (pressure of 0.25 atm) |
| Method | Dipeptide solution prepared at a concentration of 0.1 wt% in water. one molar equivalent of NaOH (1.0 M) solution into the stock solution of dipeptide for pH adjustment. 4 mL of the gelator solution was placed in a 15 mL glass vial. This vial was placed in a 3-inlet glass chamber thermostatted at 22°C, with a measured humidity of 45 %. CO2 was then added to the chamber above the vial at a required pressure for a desired period of time |
| Conc | 1 wt% |
| Temperature | Initial pH 10 and final pH 6 |
| Temperature | 22 +/- 1°C |
| Incubation Time | 30 minutes |
| Year | 2014 |
| Self assembly | Yes |
| Type of Self assembly | Transparent gel membrane |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| Structure of dipeptide given in paper | |
| NA | |
| Hydrogel | |
| 1500000 | |
| AV | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1425, |
| PMID | 26086903 |
| Peptide Name | Ala-Val |
| Peptide sequence | AV |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | Pyrimidine |
| Method | Dipeptide dissolved in solvent at conc 2mg/ml at 50 °C for 5 min and cooled to room temperature. This solution was then placed on cleaned silicon wafers orglass slides and dried until the solvent evaporated. |
| Conc | 2mg/ml |
| Temperature | Room temperature |
| Year | 2015 |
| Self assembly | Yes |
| Type of Self assembly | Rod like Nanostructure |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanorod | |
| NA | |
| AV | |
| N[C@@H](C)C(=O)N[C@@H](C(C)C)C=O | |
| Primary information | |
| SAPdb ID | 1426, |
| PMID | 26086903 |
| Peptide Name | Ala-Val |
| Peptide sequence | AV |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | 2- propanol |
| Method | Dipeptide dissolved in solvent at conc 2mg/ml at 50 °C for 5 min and cooled to room temperature. This solution was then placed on cleaned silicon wafers orglass slides and dried until the solvent evaporated. |
| Conc | 2mg/ml |
| Temperature | Room temperature |
| Year | 2015 |
| Self assembly | Yes |
| Type of Self assembly | Rod like Nanostructure |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanorod | |
| NA | |
| AV | |
| N[C@@H](C)C(=O)N[C@@H](C(C)C)C=O | |
| Primary information | |
| SAPdb ID | 1515, |
| PMID | 20695592 |
| Peptide Name | Dipeptide 3 |
| Peptide sequence | AV |
| N-Terminal Modification | Napthalene |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Water + NaOH + 8.75 mg/ml GdL(glucono-delta-lactone) |
| Method | Dipeptide solution mixed with equimolar solution of 0.1M NaOH followd by gentle stirring for 30 minutes to obtain clear solution. Then to lower the pH GdL is added and kept it undisturbed for 24 hours to get gel. |
| Conc | 0.5%wt |
| Temperature | 3.4 +/- 0.2. |
| Temperature | Room temperature |
| Incubation Time | > 24 hours |
| Year | 2010 |
| Self assembly | No |
| Type of Self assembly | No gel formation |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| None | |
| NA | |
| AV | |
| N[C@@H](Cc1ccc2c(c1)cccc2)C(=O)N[C@@H](C(C)C)C=O | |
| Primary information | |
| SAPdb ID | 1521, |
| PMID | 20695592 |
| Peptide Name | Dipeptide 9 |
| Peptide sequence | AV |
| N-Terminal Modification | Bromo-Napthalene or napthalene derivative |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Water + NaOH + 8.75 mg/ml GdL(glucono-delta-lactone) |
| Method | Dipeptide solution mixed with equimolar solution of 0.1M NaOH followd by gentle stirring for 30 minutes to obtain clear solution. Then to lower the pH GdL is added and kept it undisturbed for 24 hours to get gel. |
| Conc | 0.5%wt |
| Temperature | 3.4 +/- 0.2. |
| Temperature | Room temperature |
| Incubation Time | > 24 hours |
| Year | 2010 |
| Self assembly | Yes |
| Type of Self assembly | Transparent gel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable | |
| Hydrogel | |
| NA | |
| AV | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1527, |
| PMID | 20695592 |
| Peptide Name | Dipeptide 15 |
| Peptide sequence | AV |
| N-Terminal Modification | Cyano-Napthalene or napthalene derivative |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Water + NaOH + 8.75 mg/ml GdL(glucono-delta-lactone) |
| Method | Dipeptide solution mixed with equimolar solution of 0.1M NaOH followd by gentle stirring for 30 minutes to obtain clear solution. Then to lower the pH GdL is added and kept it undisturbed for 24 hours to get gel. |
| Conc | 0.5%wt |
| Temperature | 3.4 +/- 0.2. |
| Temperature | Room temperature |
| Incubation Time | > 24 hours |
| Year | 2010 |
| Self assembly | No |
| Type of Self assembly | No gel formation |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| None | |
| NA | |
| AV | |
| N.A. | |