Details of SAPdb entry with Sequence FG |
| Primary information | |
|---|---|
| SAPdb ID | 1239, |
| PMID | 20695592 |
| Peptide Name | Dipeptide 5 |
| Peptide sequence | FG |
| N-Terminal Modification | Napthalene |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Conjugate |
| Conjugate partner | Napthalene |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Deionized water + 0.1 M Sodium hydroxide + glucono-δ-lactone (GdL) |
| Method | Stock solutions of dipeptide-conjugates at a concentration of (0.5 wt%) were prepared and equimolar NaOH (0.1M ) added to it. These were then diluted with pH 10 water to a number of concentrations. To adjust the pH, for each dipeptide-conjugate solution and required quantity of GdL is added to solution to ensure final pH between 3.2 -3.6. Samples were left to stand at least 24 h. |
| Conc | 0.5 wt% |
| Temperature | 3.4 +/- 0.2. |
| Temperature | Room temperature |
| Incubation Time | 24 hours |
| Year | 2010 |
| Self assembly | Yes |
| Type of Self assembly | Turbid Gel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Hydrogel | |
| NA | |
| FG | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1245, |
| PMID | 20695592 |
| Peptide Name | Dipeptide 11 |
| Peptide sequence | FG |
| N-Terminal Modification | Bromo-Napthalene or napthalene derivative |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Conjugate |
| Conjugate partner | Bromo-Napthalene |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Deionized water + 0.1 M Sodium hydroxide + glucono-δ-lactone (GdL) |
| Method | Stock solutions of dipeptide-conjugates at a concentration of (0.5 wt%) were prepared and equimolar NaOH (0.1M ) added to it. These were then diluted with pH 10 water to a number of concentrations. To adjust the pH, for each dipeptide-conjugate solution and required quantity of GdL is added to solution to ensure final pH between 3.2 -3.6. Samples were left to stand at least 24 h. |
| Conc | 0.5 wt% |
| Temperature | 3.4 +/- 0.2. |
| Temperature | Room temperature |
| Incubation Time | 24 hours |
| Year | 2010 |
| Self assembly | Yes |
| Type of Self assembly | Turbid Gel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Others | |
| NA | |
| FG | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1251, |
| PMID | 20695592 |
| Peptide Name | Dipeptide 18 |
| Peptide sequence | FG |
| N-Terminal Modification | Cyano-Napthalene or napthalene derivative |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Conjugate |
| Conjugate partner | Nitrile-Napthalene |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Deionized water + 0.1 M Sodium hydroxide + glucono-δ-lactone (GdL) |
| Method | Stock solutions of dipeptide-conjugates at a concentration of (0.5 wt%) were prepared and equimolar NaOH (0.1M ) added to it. These were then diluted with pH 10 water to a number of concentrations. To adjust the pH, for each dipeptide-conjugate solution and required quantity of GdL is added to solution to ensure final pH between 3.2 -3.6. Samples were left to stand at least 24 h. |
| Conc | 0.5 wt% |
| Temperature | 3.4 +/- 0.2. |
| Temperature | Room temperature |
| Incubation Time | 24 hours |
| Year | 2010 |
| Self assembly | Yes |
| Type of Self assembly | Transparent Gel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Hydrogel | |
| NA | |
| FG | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1268, |
| PMID | 19705843 |
| Peptide Name | Fmoc-FG |
| Peptide sequence | FG |
| N-Terminal Modification | Fmoc(fluorenylmethoxycarbonyl) |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | TEM (Transmission Electron Microscopy), AFM (Atomic Force Microscopy) |
| Solvent | Water |
| Method | Peptide first dissolved in DMSO and then diluted in water to their final concentration 5mg/ml. Self assembled structure formed at room temperature |
| Conc | 5mg/ml |
| Temperature | pH 3 - 12 |
| Temperature | Room temperature |
| Year | 2009 |
| Self assembly | Yes |
| Type of Self assembly | Hydrogel (Tangled Fibrous Nano structure) |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable at pH < 6.5 | |
| Hydrogel | |
| 20 | |
| FG | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1338, |
| PMID | 23884374 |
| Peptide Name | Cyclo(L-Phe-Gly) or Dipeptide 1 |
| Peptide sequence | FG |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | Phosphate buffer (pH 6) |
| Conc | 2% w/v |
| Temperature | pH 7 |
| Year | 2013 |
| Self assembly | Yes |
| Type of Self assembly | Opaque Hydrogel gel (Nanofibers) |
| Tertiary Structure (Technique) | Not Predicted), |
| Cyclic | |
| NA | |
| Stable at high temperature | |
| Hydrogel | |
| NA | |
| FG | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1408, |
| PMID | 25229206 |
| Peptide Name | NDI-Phe-Gly or 2 |
| Peptide sequence | FG |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Mixture |
| Conjugate partner | NDI : 1,4,5,8-naphthalenetetracarboxylic acid diimide |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Water |
| Method | 2mg compound was dissolved in 0.2ml solvent by heating. Gelation occur at room temperature. |
| Conc | 2% wt |
| Temperature | pH 4.7 |
| Temperature | Room temperature |
| Year | 2014 |
| Self assembly | Yes |
| Type of Self assembly | Hydrogel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable | |
| Hydrogel | |
| NA | |
| FG | |
| N[C@@H](Cc1ccccc1)C(=O)NCC=O | |
| Primary information | |
| SAPdb ID | 1412, |
| PMID | 25229206 |
| Peptide Name | NDI-Phe-Gly or 2 |
| Peptide sequence | FG |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Mixture |
| Conjugate partner | NDI : 1,4,5,8-naphthalenetetracarboxylic acid diimide |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Water |
| Method | 2mg compound was dissolved in 0.2ml solvent by heating. Gelation occur at room temperature. |
| Conc | 2% wt |
| Temperature | pH 7.4 |
| Temperature | Room temperature |
| Year | 2014 |
| Self assembly | Yes |
| Type of Self assembly | Transparent Hydrogel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable | |
| Hydrogel | |
| NA | |
| FG | |
| N[C@@H](Cc1ccccc1)C(=O)NCC=O | |
| Primary information | |
| SAPdb ID | 1479, |
| PMID | 22651803 |
| Peptide Name | Dipeptide7 |
| Peptide sequence | FG |
| N-Terminal Modification | Napthalene |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | SEM (Scanning Electron Microscopy) and X - Ray Diffraction |
| Solvent | Water + 0.1 M NaOH |
| Method | 25mg of dipeptide was suspended in deionized 5ml water . An equimolar amount of NaOH (0.1 M,aq) was added, and the solution was gently stirred until a clear solution was formed. Glucono-δ- lactone (GdL) was added to the solution and the samples were gently swirled to dissolve the GdL before being left to stand for 24 h without stirring to form gel. |
| Conc | 5mg/ml or 0.5%wt |
| Temperature | Room temperature |
| Incubation Time | 24 hours |
| Year | 2012 |
| Self assembly | Yes |
| Type of Self assembly | Turbid gel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Hydrogel | |
| NA | |
| FG | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1484, |
| PMID | 22651803 |
| Peptide Name | Dipeptide16 |
| Peptide sequence | FG |
| N-Terminal Modification | Napthalene |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | SEM (Scanning Electron Microscopy) and X - Ray Diffraction |
| Solvent | Water + 0.1 M NaOH |
| Method | 25mg of dipeptide was suspended in deionized 5ml water . An equimolar amount of NaOH (0.1 M,aq) was added, and the solution was gently stirred until a clear solution was formed. Glucono-δ- lactone (GdL) was added to the solution and the samples were gently swirled to dissolve the GdL before being left to stand for 24 h without stirring to form gel. |
| Conc | 5mg/ml or 0.5%wt |
| Temperature | Room temperature |
| Incubation Time | 24 hours |
| Year | 2012 |
| Self assembly | Yes |
| Type of Self assembly | Transparent or clear gel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Hydrogel | |
| NA | |
| FG | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1516, |
| PMID | 20695592 |
| Peptide Name | Dipeptide 4 |
| Peptide sequence | FG |
| N-Terminal Modification | Napthalene |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Water + NaOH + 8.75 mg/ml GdL(glucono-delta-lactone) |
| Method | Dipeptide solution mixed with equimolar solution of 0.1M NaOH followd by gentle stirring for 30 minutes to obtain clear solution. Then to lower the pH GdL is added and kept it undisturbed for 24 hours to get gel. |
| Conc | 0.5%wt |
| Temperature | 3.4 +/- 0.2. |
| Temperature | Room temperature |
| Incubation Time | > 24 hours |
| Year | 2010 |
| Self assembly | Yes |
| Type of Self assembly | Transparent gel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable | |
| Hydrogel | |
| NA | |
| FG | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1522, |
| PMID | 20695592 |
| Peptide Name | Dipeptide 10 |
| Peptide sequence | FG |
| N-Terminal Modification | Bromo-Napthalene or napthalene derivative |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Water + NaOH + 8.75 mg/ml GdL(glucono-delta-lactone) |
| Method | Dipeptide solution mixed with equimolar solution of 0.1M NaOH followd by gentle stirring for 30 minutes to obtain clear solution. Then to lower the pH GdL is added and kept it undisturbed for 24 hours to get gel. |
| Conc | 0.5%wt |
| Temperature | 3.4 +/- 0.2. |
| Temperature | Room temperature |
| Incubation Time | > 24 hours |
| Year | 2010 |
| Self assembly | Yes |
| Type of Self assembly | Transparent gel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable | |
| Hydrogel | |
| NA | |
| FG | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1528, |
| PMID | 20695592 |
| Peptide Name | Dipeptide 16 |
| Peptide sequence | FG |
| N-Terminal Modification | Cyano-Napthalene or napthalene derivative |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Water + NaOH + 8.75 mg/ml GdL(glucono-delta-lactone) |
| Method | Dipeptide solution mixed with equimolar solution of 0.1M NaOH followd by gentle stirring for 30 minutes to obtain clear solution. Then to lower the pH GdL is added and kept it undisturbed for 24 hours to get gel. |
| Conc | 0.5%wt |
| Temperature | 3.4 +/- 0.2. |
| Temperature | Room temperature |
| Incubation Time | > 24 hours |
| Year | 2010 |
| Self assembly | Yes |
| Type of Self assembly | Transparent gel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable | |
| Hydrogel | |
| NA | |
| FG | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1573, |
| PMID | 21995651 |
| Peptide Name | FmocFG |
| Peptide sequence | FG |
| N-Terminal Modification | Fmoc(fluorenylmethoxycarbonyl) |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Water + Sodium hydroxide + HCl |
| Method | Fmocdipeptide was suspended in water. Sodium hydroxide (0.5 M) was gradually added to the aqueous suspensions of Fmoc dipeptide until pH 10.5 was reached. The samples were vortexed and sonicated for 1 min to fully dissolve the short peptide amphiphiles. 0.085 M HCl added dropwise to attain desired pH, followed by vortexing and sonication. Sample heated to 75-80 °C fto dissolve the peptide.. The sample was subsequently cooled and maintained at 4 °C for∼12 h (overnight) to promote or maintain gelation. |
| Conc | 1- 20 mmlol/L |
| Temperature | 10.5 |
| Temperature | Intial boiling to 75 -80°C heating for 2 minutes and followed by cooling at 4°C |
| Incubation Time | 12 hours |
| Year | 2011 |
| Self assembly | Yes |
| Type of Self assembly | Twisted Ribbon |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanoribbon | |
| 34.8 | |
| FG | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1574, |
| PMID | 21995651 |
| Peptide Name | FmocFG |
| Peptide sequence | FG |
| N-Terminal Modification | Fmoc(fluorenylmethoxycarbonyl) |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Water + Sodium hydroxide + HCl |
| Method | Fmocdipeptide was suspended in water. Sodium hydroxide (0.5 M) was gradually added to the aqueous suspensions of Fmoc dipeptide until pH 10.5 was reached. The samples were vortexed and sonicated for 1 min to fully dissolve the short peptide amphiphiles. 0.085 M HCl added dropwise to attain desired pH, followed by vortexing and sonication. Sample heated to 75-80 °C fto dissolve the peptide.. The sample was subsequently cooled and maintained at 4 °C for∼12 h (overnight) to promote or maintain gelation. |
| Conc | 1- 20 mmlol/L |
| Temperature | < 5.1 |
| Temperature | Intial boiling to 75 -80°C heating for 2 minutes and followed by cooling at 4°C |
| Incubation Time | 12 hours |
| Year | 2011 |
| Self assembly | Yes |
| Type of Self assembly | Transparent hydrogel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable | |
| Hydrogel | |
| 34.8 | |
| FG | |
| N.A. | |