Welcome to Sequence Card of Peptide
Details of SAPdb entry with Sequence KFG |
| Primary information | |
|---|---|
| SAPdb ID | 1078, |
| PMID | 24338837 |
| Peptide Name | KFG |
| Peptide sequence | KFG |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | TEM (Transmission Electron Microscopy), DLS (Dynamic Light Scattering) and AFM (Atomic Force Microscopy) |
| Solvent | Water |
| Method | Peptide dispersed in PBS 1X buffer (pH 7.4) in an autoclaved with brief sonication. This suspension was kept at 4 ºC. |
| Conc | 0.5mg/ml |
| Temperature | pH 7.4 |
| Temperature | 20°C-70°C |
| Year | 2014 |
| Self assembly | Yes |
| Type of Self assembly | Vesicular Nanostructure |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable at pH 7.4, unstable at 90°C | |
| Nanovesicle | |
| 50 | |
| None | |
| N[C@@H](CCCC[NH3])C(=O)N[C@@H](Cc1ccccc1)C(=O)NCC=O | |
| Primary information | |
| SAPdb ID | 1079, |
| PMID | 24338837 |
| Peptide Name | KFG |
| Peptide sequence | KFG |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | TEM (Transmission Electron Microscopy), DLS (Dynamic Light Scattering) and AFM (Atomic Force Microscopy) |
| Solvent | Water |
| Method | Peptide dispersed in PBS 1X buffer (pH 7.4) in an autoclaved with brief sonication. This suspension was kept at 4 ºC. |
| Conc | 5mg/ml |
| Temperature | pH 7.4 |
| Temperature | 20°C-70°C |
| Year | 2014 |
| Self assembly | Yes |
| Type of Self assembly | Nanotube structure |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable at 90°C | |
| Nanotube | |
| 190 | |
| None | |
| N[C@@H](CCCC[NH3])C(=O)N[C@@H](Cc1ccccc1)C(=O)NCC=O | |
| Primary information | |
| SAPdb ID | 1080, |
| PMID | 24338837 |
| Peptide Name | KFG |
| Peptide sequence | KFG |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | TEM (Transmission Electron Microscopy), DLS (Dynamic Light Scattering) and AFM (Atomic Force Microscopy) |
| Solvent | Water |
| Method | Peptide dispersed in PBS 1X buffer (pH 7.4) in an autoclaved with brief sonication. This suspension was kept at 4 ºC. |
| Conc | 5mg/ml |
| Temperature | pH 7.4 |
| Temperature | 20°C-70°C |
| Year | 2014 |
| Self assembly | Yes |
| Type of Self assembly | Spherical Nano structures |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable at 90°C | |
| Nanosphere | |
| 50 | |
| None | |
| N[C@@H](CCCC[NH3])C(=O)N[C@@H](Cc1ccccc1)C(=O)NCC=O | |
| Primary information | |
| SAPdb ID | 1081, |
| PMID | 24338837 |
| Peptide Name | KFG |
| Peptide sequence | KFG |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | TEM (Transmission Electron Microscopy), DLS (Dynamic Light Scattering) and AFM (Atomic Force Microscopy) |
| Solvent | Water |
| Method | Peptide dispersed in PBS 1X buffer (pH 7.4) in an autoclaved with brief sonication. This suspension was kept at 4 ºC. |
| Conc | 0.5-5mg/ml - mg/ml |
| Temperature | pH 6 |
| Temperature | 20°C-70°C |
| Year | 2014 |
| Self assembly | No |
| Type of Self assembly | No aggregation |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| None | |
| NA | |
| None | |
| N[C@@H](CCCC[NH3])C(=O)N[C@@H](Cc1ccccc1)C(=O)NCC=O | |