Details of SAPdb entry with Sequence VA |
| Primary information | |
|---|---|
| SAPdb ID | 1418, |
| PMID | 26086903 |
| Peptide Name | Val-Ala |
| Peptide sequence | VA |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | Pyrimidine |
| Method | Dipeptide dissolved in solvent at conc 2mg/ml at 50 °C for 5 min and cooled to room temperature. This solution was then placed on cleaned silicon wafers orglass slides and dried until the solvent evaporated. |
| Conc | 2mg/ml |
| Temperature | Room temperature |
| Year | 2015 |
| Self assembly | Yes |
| Type of Self assembly | Square plate-like structures |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Others | |
| NA | |
| VA | |
| N[C@@H](C(C)C)C(=O)N[C@@H](C)C=O | |
| Primary information | |
| SAPdb ID | 1419, |
| PMID | 26086903 |
| Peptide Name | Val-Ala |
| Peptide sequence | VA |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | 2- propanol |
| Method | Dipeptide dissolved in solvent at conc 2mg/ml at 50 °C for 5 min and cooled to room temperature. This solution was then placed on cleaned silicon wafers orglass slides and dried until the solvent evaporated. |
| Conc | 2mg/ml |
| Temperature | Room temperature |
| Year | 2015 |
| Self assembly | Yes |
| Type of Self assembly | Wire like structures |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanowire | |
| NA | |
| VA | |
| N[C@@H](C(C)C)C(=O)N[C@@H](C)C=O | |
| Primary information | |
| SAPdb ID | 1420, |
| PMID | 26086903 |
| Peptide Name | Val-Ala |
| Peptide sequence | VA |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | Ethanol |
| Method | Dipeptide dissolved in solvent at conc 2mg/ml at 50 °C for 5 min and cooled to room temperature. This solution was then placed on cleaned silicon wafers orglass slides and dried until the solvent evaporated. |
| Conc | 2mg/ml |
| Temperature | Room temperature |
| Year | 2015 |
| Self assembly | Yes |
| Type of Self assembly | Irregular rod like aggregate structure |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Others | |
| NA | |
| VA | |
| N[C@@H](C(C)C)C(=O)N[C@@H](C)C=O | |
| Primary information | |
| SAPdb ID | 1421, |
| PMID | 26086903 |
| Peptide Name | Val-Ala |
| Peptide sequence | VA |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | Pyrimidine |
| Method | Dipeptide dissolved in solvent at conc 2mg/ml at 50 °C for 5 min and cooled to room temperature. This solution was then placed on cleaned silicon wafers orglass slides and dried until the solvent evaporated. |
| Conc | 0.5mg/ml |
| Temperature | Room temperature |
| Year | 2015 |
| Self assembly | Yes |
| Type of Self assembly | Irregular rod-like aggregates as well as plate-like structures |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Others | |
| NA | |
| VA | |
| N[C@@H](C(C)C)C(=O)N[C@@H](C)C=O | |
| Primary information | |
| SAPdb ID | 1422, |
| PMID | 26086903 |
| Peptide Name | Val-Ala |
| Peptide sequence | VA |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | Pyrimidine |
| Method | Dipeptide dissolved in solvent at conc 2mg/ml at 50 °C for 5 min and cooled to room temperature. This solution was then placed on cleaned silicon wafers orglass slides and dried until the solvent evaporated. |
| Conc | 1mg/ml |
| Temperature | Room temperature |
| Year | 2015 |
| Self assembly | Yes |
| Type of Self assembly | Rectangular plate-like |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Others | |
| NA | |
| VA | |
| N[C@@H](C(C)C)C(=O)N[C@@H](C)C=O | |
| Primary information | |
| SAPdb ID | 1423, |
| PMID | 26086903 |
| Peptide Name | Val-Ala |
| Peptide sequence | VA |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | Pyrimidine |
| Method | Dipeptide dissolved in solvent at conc 2mg/ml at 50 °C for 5 min and cooled to room temperature. This solution was then placed on cleaned silicon wafers orglass slides and dried until the solvent evaporated. |
| Conc | 4mg/ml |
| Temperature | Room temperature |
| Year | 2015 |
| Self assembly | Yes |
| Type of Self assembly | Irregular plates |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Others | |
| NA | |
| VA | |
| N[C@@H](C(C)C)C(=O)N[C@@H](C)C=O | |
| Primary information | |
| SAPdb ID | 1424, |
| PMID | 26086903 |
| Peptide Name | Val-Ala |
| Peptide sequence | VA |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | 2- propanol |
| Method | Dipeptide dissolved in solvent at conc 2mg/ml at 50 °C for 5 min and cooled to room temperature. This solution was then placed on cleaned silicon wafers orglass slides and dried until the solvent evaporated. |
| Conc | 0.5, 1.0, 4.0mg/ml |
| Temperature | Room temperature |
| Year | 2015 |
| Self assembly | Yes |
| Type of Self assembly | Irregular rod-like structures |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Others | |
| NA | |
| VA | |
| N[C@@H](C(C)C)C(=O)N[C@@H](C)C=O | |
| Primary information | |
| SAPdb ID | 1427, |
| PMID | 26086903 |
| Peptide Name | Val-Ala |
| Peptide sequence | VA |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | 30% 2-propanol with pyridine |
| Method | Dipeptide dissolved in solvent at conc 2mg/ml at 50 °C for 5 min and cooled to room temperature. This solution was then placed on cleaned silicon wafers orglass slides and dried until the solvent evaporated. |
| Conc | 2mg/ml |
| Temperature | Room temperature |
| Year | 2015 |
| Self assembly | Yes |
| Type of Self assembly | Rectangular-plate |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Others | |
| NA | |
| VA | |
| N[C@@H](C(C)C)C(=O)N[C@@H](C)C=O | |
| Primary information | |
| SAPdb ID | 1428, |
| PMID | 26086903 |
| Peptide Name | Val-Ala |
| Peptide sequence | VA |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | 50% 2-propanol with pyridine |
| Method | Dipeptide dissolved in solvent at conc 2mg/ml at 50 °C for 5 min and cooled to room temperature. This solution was then placed on cleaned silicon wafers orglass slides and dried until the solvent evaporated. |
| Conc | 2mg/ml |
| Temperature | Room temperature |
| Year | 2015 |
| Self assembly | Yes |
| Type of Self assembly | Extended rectangular-plate |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Others | |
| NA | |
| VA | |
| N[C@@H](C(C)C)C(=O)N[C@@H](C)C=O | |
| Primary information | |
| SAPdb ID | 1429, |
| PMID | 26086903 |
| Peptide Name | Val-Ala |
| Peptide sequence | VA |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | 70% 2-propanol with pyridine |
| Method | Dipeptide dissolved in solvent at conc 2mg/ml at 50 °C for 5 min and cooled to room temperature. This solution was then placed on cleaned silicon wafers orglass slides and dried until the solvent evaporated. |
| Conc | 2mg/ml |
| Temperature | Room temperature |
| Year | 2015 |
| Self assembly | Yes |
| Type of Self assembly | Dense and well-structured rod-like structures |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanorod | |
| NA | |
| VA | |
| N[C@@H](C(C)C)C(=O)N[C@@H](C)C=O | |