Details of SAPdb entry with Sequence ECG |
| Primary information | |
|---|---|
| SAPdb ID | 1114, |
| PMID | 11457225 |
| Peptide Name | Oxidized Glutathione |
| Peptide sequence | ECG |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | TEM (Transmission Electron Microscopy), CD (Circular Dichroism spectroscopy) and NMR |
| Solvent | DMSO |
| Method | Gels in DMSO were prepared by dissolution of oxidized glutathione (GSSG) with gentle heating to about 60 °C. |
| Conc | 8mM |
| Temperature | 60°C |
| Incubation Time | 1 week |
| Year | 2001 |
| Self assembly | Yes |
| Type of Self assembly | Gel consists of fibril structure |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable at room temperature for months; Unstable above 50°C | |
| Hydrogel | |
| NA | |
| None | |
| N[C@@H](CCC(=O)O)C(=O)N[C@@H](CS)C(=O)NCCO | |
| Primary information | |
| SAPdb ID | 1115, |
| PMID | 11457225 |
| Peptide Name | Reduced Glutathione |
| Peptide sequence | ECG |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | TEM (Transmission Electron Microscopy), CD (Circular Dichroism spectroscopy) and NMR |
| Solvent | DMSO |
| Method | Gels in DMSO were prepared by dissolution of reduced glutathione (GSH) with gentle heating to about 60 °C. |
| Conc | 16mM |
| Temperature | 60°C |
| Incubation Time | 2 weeks |
| Year | 2001 |
| Self assembly | Yes |
| Type of Self assembly | Gel consists of fibril structure |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable at room temperature for months; Unstable above 50°C | |
| Hydrogel | |
| NA | |
| None | |
| N[C@@H](CCC(=O)O)C(=O)N[C@@H](CS)C(=O)NCC=O | |
| Primary information | |
| SAPdb ID | 1116, |
| PMID | 11457225 |
| Peptide Name | Glutathione |
| Peptide sequence | ECG |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | TEM (Transmission Electron Microscopy), CD (Circular Dichroism spectroscopy) and NMR |
| Solvent | 90% DMF + 10% water |
| Method | Solutions prepared by adding DMF to aqueous GSSG solutions produce gels within minutes at concentrations as low as 5 mM (3 mg/mL) in 90% DMF. |
| Conc | 3mg/ml or 5mM |
| Temperature | 65°C |
| Incubation Time | few minutes |
| Year | 2001 |
| Self assembly | Yes |
| Type of Self assembly | Gel consists of fibril structure |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable at room temperature for months; Unstable above 50°C | |
| Hydrogel | |
| NA | |
| None | |
| N[C@@H](CCC(=O)O)C(=O)N[C@@H](CS)C(=O)NCC=O | |
| Primary information | |
| SAPdb ID | 1117, |
| PMID | 11457225 |
| Peptide Name | Glutathione |
| Peptide sequence | ECG |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | TEM (Transmission Electron Microscopy), CD (Circular Dichroism spectroscopy) and NMR |
| Solvent | 90% Methanol + 10%water |
| Method | Solutions prepared by adding methanol to aqueous GSSG solutions require cooling to about 0 °C to produce transparent gels |
| Conc | 0.9mg/ml or 1.5mM |
| Temperature | 0°C |
| Incubation Time | 1 week |
| Year | 2001 |
| Self assembly | Yes |
| Type of Self assembly | Gel consists of fibril structure |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable at room temperature for months; Unstable above 50°C | |
| Hydrogel | |
| NA | |
| None | |
| N[C@@H](CCC(=O)O)C(=O)N[C@@H](CS)C(=O)NCC=O | |
| Primary information | |
| SAPdb ID | 1118, |
| PMID | 16029045 |
| Peptide Name | Glutathione |
| Peptide sequence | ECG |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | Conjugate |
| Conjugate partner | Conjugated with pyrene |
| Technique | TEM (Transmission Electron Microscopy), SEM (Scanning Electron Microscopy) and CD (Circular Dichroism spectroscopy) |
| Solvent | 95%water+ 5% DMSO |
| Method | Addition of water to peptide-conjuagate stock solution in DMSO in ratio (5:95) at final conc 1-10mM. It immediately generate transparent and flourescent gel. |
| Conc | 10mM |
| Year | 2005 |
| Self assembly | Yes |
| Type of Self assembly | Transparent gel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable | |
| Hydrogel | |
| 75 | |
| None | |
| N[C@@H](CCC(=O)O)C(=O)N[C@@H](CS)C(=O)NCC=O | |