Details of SAPdb entry with Sequence aa |
| Primary information | |
|---|---|
| SAPdb ID | 1016, |
| PMID | 16430299 |
| Peptide Name | NH2-(L)Ala-(L)Ala-COOH |
| Peptide sequence | AA |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | CD (Circular Dichroism spectroscopy) |
| Solvent | Aqueous dispersion |
| Method | The stock solution was dissolved in dd water to conc of 0.04 mg/ml |
| Conc | 2mg/ml |
| Temperature | 90°C |
| Incubation Time | Within few minutes |
| Year | 2006 |
| Self assembly | No |
| Type of Self assembly | None |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Unstable | |
| None | |
| NA | |
| AA | |
| N[C@@H](C)C(=O)N[C@@H](C)C=O | |
| Primary information | |
| SAPdb ID | 1212, |
| PMID | 26016677 |
| Peptide Name | MAA (Myristic acid containing alanine dipeptide) |
| Peptide sequence | AA |
| N-Terminal Modification | Myristic acid |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | X - ray scattering (SAXS), powder X - ray diffraction (PXRD), field Emission Scanning electron microscopic (FE - SEM) and high - Resolution Transmission electron microscopic (HR - TEM) imaging |
| Solvent | Phosphate buffer |
| Method | The dipeptide gelator 4.5 mg weighed in a glass vial and 1 mL of phosphate buffer was added and heated to 70 -80°C on a hot plate tomake a clear solution of the peptide. This solution transferred to water bath. The solution was then allowed to come down to room temperature to form a hydrogel. |
| Conc | 4.5mg/ml |
| Temperature | 7.46 |
| Temperature | Room temperature |
| Incubation Time | 2 hours |
| Year | 2015 |
| Self assembly | Yes |
| Type of Self assembly | Transparent hydrogel (consist of helical fibers) |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Hydrogel | |
| 450 | |
| AA | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1213, |
| PMID | 26016677 |
| Peptide Name | MAA (Myristic acid containing alanine dipeptide) |
| Peptide sequence | AA |
| N-Terminal Modification | Myristic acid |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | X - ray scattering (SAXS), powder X - ray diffraction (PXRD), field Emission Scanning electron microscopic (FE - SEM) and high - Resolution Transmission electron microscopic (HR - TEM) imaging |
| Solvent | Phosphate buffer |
| Method | The dipeptide gelator 4.5 mg weighed in a glass vial and 1 mL of phosphate buffer was added and heated to 70 -80°C on a hot plate tomake a clear solution of the peptide. This solution transferred to water bath. The solution was then allowed to come down to room temperature to form a hydrogel. |
| Conc | 4.5mg/ml |
| Temperature | 7.46 |
| Temperature | Room temperature |
| Incubation Time | 48 hours |
| Year | 2015 |
| Self assembly | Yes |
| Type of Self assembly | Turbid gel (consists of fibers) |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Hydrogel | |
| 95 | |
| AA | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1237, |
| PMID | 20695592 |
| Peptide Name | Dipeptide 2 |
| Peptide sequence | AA |
| N-Terminal Modification | Napthalene |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Conjugate |
| Conjugate partner | Napthalene |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Deionized water + 0.1 M Sodium hydroxide + glucono-δ-lactone (GdL) |
| Method | Stock solutions of dipeptide-conjugates at a concentration of (0.5 wt%) were prepared and equimolar NaOH (0.1M ) added to it. These were then diluted with pH 10 water to a number of concentrations. To adjust the pH, for each dipeptide-conjugate solution and required quantity of GdL is added to solution to ensure final pH between 3.2 -3.6. Samples were left to stand at least 24 h. |
| Conc | 0.5 wt% |
| Temperature | 3.4 +/- 0.2. |
| Temperature | Room temperature |
| Incubation Time | 24 hours |
| Year | 2010 |
| Self assembly | Yes |
| Type of Self assembly | Transparent Gel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Hydrogel | |
| NA | |
| AA | |
| N[C@@H](Cc1ccc2c(c1)cccc2)C(=O)N[C@@H](C)C=O | |
| Primary information | |
| SAPdb ID | 1243, |
| PMID | 20695592 |
| Peptide Name | Dipeptide 9 |
| Peptide sequence | AA |
| N-Terminal Modification | Bromo-Napthalene or napthalene derivative |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Conjugate |
| Conjugate partner | Bromo-Napthalene |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Deionized water + 0.1 M Sodium hydroxide + glucono-δ-lactone (GdL) |
| Method | Stock solutions of dipeptide-conjugates at a concentration of (0.5 wt%) were prepared and equimolar NaOH (0.1M ) added to it. These were then diluted with pH 10 water to a number of concentrations. To adjust the pH, for each dipeptide-conjugate solution and required quantity of GdL is added to solution to ensure final pH between 3.2 -3.6. Samples were left to stand at least 24 h. |
| Conc | 0.5 wt% |
| Temperature | 3.4 +/- 0.2. |
| Temperature | Room temperature |
| Incubation Time | 24 hours |
| Year | 2010 |
| Self assembly | Yes |
| Type of Self assembly | Transparent Gel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Hydrogel | |
| NA | |
| AA | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1249, |
| PMID | 20695592 |
| Peptide Name | Dipeptide 16 |
| Peptide sequence | AA |
| N-Terminal Modification | Cyano-Napthalene or napthalene derivative |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Conjugate |
| Conjugate partner | Nitrile-Napthalene |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Deionized water + 0.1 M Sodium hydroxide + glucono-δ-lactone (GdL) |
| Method | Stock solutions of dipeptide-conjugates at a concentration of (0.5 wt%) were prepared and equimolar NaOH (0.1M ) added to it. These were then diluted with pH 10 water to a number of concentrations. To adjust the pH, for each dipeptide-conjugate solution and required quantity of GdL is added to solution to ensure final pH between 3.2 -3.6. Samples were left to stand at least 24 h. |
| Conc | 0.5 wt% |
| Temperature | 3.4 +/- 0.2. |
| Temperature | Room temperature |
| Incubation Time | 24 hours |
| Year | 2010 |
| Self assembly | Yes |
| Type of Self assembly | Transparent Gel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Hydrogel | |
| NA | |
| AA | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1256, |
| PMID | 19503864 |
| Peptide Name | D-Ala–D-Ala |
| Peptide sequence | aa |
| N-Terminal Modification | MC or merocyanine |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | Water |
| Method | Peptide dissolved in water and pH of solution is lowered to 3 by addition HCl. It forms hydogel at final conc of peptide is 11 nm at room temperature. |
| Conc | 11mM |
| Temperature | ~ 3 |
| Temperature | Room temperature |
| Year | 2009 |
| Self assembly | Yes |
| Type of Self assembly | Hydrogel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| unstable under photo-exposure and heating under acidic conditions | |
| Hydrogel | |
| NA | |
| aa | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1257, |
| PMID | 19503864 |
| Peptide Name | D-Ala–D-Ala |
| Peptide sequence | aa |
| N-Terminal Modification | Vancomycin |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | Water |
| Method | Peptide dissolved in water and pH of solution is lowered to 3 by addition HCl. It forms hydogel at final conc of peptide is 11 nm at room temperature. |
| Conc | 11mM |
| Temperature | ~ 3 |
| Temperature | Room temperature |
| Year | 2009 |
| Self assembly | No |
| Type of Self assembly | No hydrogel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| None | |
| NA | |
| aa | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1258, |
| PMID | 19503864 |
| Peptide Name | D-Ala–D-Ala |
| Peptide sequence | aa |
| N-Terminal Modification | Spiropyran (SP) |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | Water |
| Method | Peptide dissolved in water and pH of solution is lowered to 3 by addition HCl. It forms hydogel at final conc of peptide is 11 nm at room temperature. |
| Conc | 11mM |
| Temperature | ~ 3 |
| Temperature | Room temperature |
| Year | 2009 |
| Self assembly | Yes |
| Type of Self assembly | Unstable hydrogel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Unstable | |
| Hydrogel | |
| NA | |
| aa | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1287, |
| PMID | 22890605 |
| Peptide Name | 2NapAA |
| Peptide sequence | AA |
| N-Terminal Modification | Napthalene |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Conjugate |
| Conjugate partner | Napthalene |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | Sodium hydoxide(0.1 M ) |
| Method | A 0.5 wt% stock solution of dipeptide at pH 9 – 10 prepaed by adding 1 equivalent of sodium hydroxide solution 0.1 M solution) with stirring to dissolve, 0.1 M HCl added to lower the pH of solution to 6.8. To form gels, 2 mL of stock solution was placed in a 7 mL Sterilin cup for 14 hours and UV light was irradiated from a 40 W Spectroline X-series UV lamp (wavelength 254 nm) . |
| Conc | 5mg/ml |
| Temperature | 6.8 |
| Temperature | Room temperature |
| Incubation Time | 14 hours |
| Year | 2012 |
| Self assembly | No |
| Type of Self assembly | No gel formation |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| None | |
| NA | |
| AA | |
| N[C@@H](Cc1ccc2c(c1)cccc2)C(=O)N[C@@H](C)C=O | |
| Primary information | |
| SAPdb ID | 1296, |
| PMID | 23020140 |
| Peptide Name | (Fmoc-AA) |
| Peptide sequence | AA |
| N-Terminal Modification | Fmoc(fluorenylmethoxycarbonyl) |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | TEM (Transmission Electron Microscopy), AFM (Atomic Force Microscopy), UV - vis - NIR, FTIR (Fourier - transform infrared spectroscopy) and CD (Circular Dichroism spectroscopy) |
| Solvent | Water + 0.1M Hcl + 0.5 M NaOH |
| Method | Peptide was added to deionized water, vortexed, and sonicated for several minutes. 1 eq 0.5 M NaOH was added and mixture was vortexed until completely clear. The mixture was then added quickly to a vial containing 1 eq 0.1 M HCl, to trigger gelation. |
| Conc | 5mg/ml |
| Temperature | 3.3 - 3.4 |
| Temperature | Room temperature |
| Incubation Time | 10 -60 minutes |
| Year | 2012 |
| Self assembly | Yes |
| Type of Self assembly | Hydrogel (Nanoribbon) |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable gel | |
| Hydrogel | |
| 30 | |
| AA | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1344, |
| PMID | 23915244 |
| Peptide Name | Ala-Ala |
| Peptide sequence | AA |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | FE - SEM (Field Emission Scanning Electron Microscopy or FE - SEM) |
| Solvent | Water |
| Method | Peptide dissolved in solvent at final conc. 20mg/ml by heating at 70 °C. Self assembled structure formed at room temperature. |
| Conc | 20mg/ml |
| Temperature | 25°C |
| Year | 2013 |
| Self assembly | Yes |
| Type of Self assembly | Left handed twisted Nanoribbon |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanoribbon | |
| 30 | |
| AA | |
| N[C@@H](C)C(=O)N[C@@H](C)C=O | |
| Primary information | |
| SAPdb ID | 1345, |
| PMID | 23915244 |
| Peptide Name | D-Ala-Ala |
| Peptide sequence | aA |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | FE - SEM (Field Emission Scanning Electron Microscopy or FE - SEM) |
| Solvent | Water |
| Method | Peptide dissolved in solvent at final conc. 20mg/ml by heating at 70 °C. Self assembled structure formed at room temperature. |
| Conc | 20mg/ml |
| Temperature | 25°C |
| Year | 2013 |
| Self assembly | Yes |
| Type of Self assembly | Left handed twisted Nanoribbon |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanoribbon | |
| 30 | |
| aA | |
| N[C@H](C)C(=O)N[C@@H](C)C=O | |
| Primary information | |
| SAPdb ID | 1346, |
| PMID | 23915244 |
| Peptide Name | Ala-D-Ala |
| Peptide sequence | Aa |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | FE - SEM (Field Emission Scanning Electron Microscopy or FE - SEM) |
| Solvent | Water |
| Method | Peptide dissolved in solvent at final conc. 20mg/ml by heating at 70 °C. Self assembled structure formed at room temperature. |
| Conc | 20mg/ml |
| Temperature | 25°C |
| Year | 2013 |
| Self assembly | Yes |
| Type of Self assembly | Right handed twisted Nanoribbon |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanoribbon | |
| 30 | |
| Aa | |
| N[C@@H](C)C(=O)N[C@H](C)C=O | |
| Primary information | |
| SAPdb ID | 1347, |
| PMID | 23915244 |
| Peptide Name | D-Ala-D-Ala |
| Peptide sequence | aa |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | FE - SEM (Field Emission Scanning Electron Microscopy or FE - SEM) |
| Solvent | Water |
| Method | Peptide dissolved in solvent at final conc. 20mg/ml by heating at 70 °C. Self assembled structure formed at room temperature. |
| Conc | 20mg/ml |
| Temperature | 25°C |
| Year | 2013 |
| Self assembly | Yes |
| Type of Self assembly | Right handed twisted Nanoribbon |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanoribbon | |
| 30 | |
| aa | |
| N[C@H](C)C(=O)N[C@H](C)C=O | |
| Primary information | |
| SAPdb ID | 1348, |
| PMID | 23915244 |
| Peptide Name | Ala-Ala |
| Peptide sequence | AA |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | FE - SEM (Field Emission Scanning Electron Microscopy or FE - SEM) |
| Solvent | Tetrahydrofuran (THF) |
| Method | Peptide dissolved in solvent at final conc. 30mg/ml by heating at 40 °C. Self assembled structure formed at room temperature. |
| Conc | 30mg/ml |
| Temperature | 25°C |
| Year | 2013 |
| Self assembly | Yes |
| Type of Self assembly | Right handed Nanoribbon |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanoribbon | |
| 125 | |
| AA | |
| N[C@@H](C)C(=O)N[C@@H](C)C=O | |
| Primary information | |
| SAPdb ID | 1349, |
| PMID | 23915244 |
| Peptide Name | L-Ala- D- Ala |
| Peptide sequence | Aa |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | FE - SEM (Field Emission Scanning Electron Microscopy or FE - SEM) |
| Solvent | Tetrahydrofuran (THF) |
| Method | Peptide dissolved in solvent at final conc. 30mg/ml by heating at 40 °C. Self assembled structure formed at room temperature. |
| Conc | 30mg/ml |
| Temperature | 25°C |
| Year | 2013 |
| Self assembly | Yes |
| Type of Self assembly | Left handed Nanoribbon |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanoribbon | |
| 125 | |
| Aa | |
| N[C@@H](C)C(=O)N[C@H](C)C=O | |
| Primary information | |
| SAPdb ID | 1350, |
| PMID | 23915244 |
| Peptide Name | D-Ala-L-Ala |
| Peptide sequence | aA |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | FE - SEM (Field Emission Scanning Electron Microscopy or FE - SEM) |
| Solvent | Tetrahydrofuran (THF) |
| Method | Peptide dissolved in solvent at final conc. 30mg/ml by heating at 40 °C. Self assembled structure formed at room temperature. |
| Conc | 30mg/ml |
| Temperature | 25°C |
| Year | 2013 |
| Self assembly | Yes |
| Type of Self assembly | Right handed Nanoribbon |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanoribbon | |
| 125 | |
| aA | |
| N[C@H](C)C(=O)N[C@@H](C)C=O | |
| Primary information | |
| SAPdb ID | 1351, |
| PMID | 23915244 |
| Peptide Name | D-Ala-D-Ala |
| Peptide sequence | aa |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | FE - SEM (Field Emission Scanning Electron Microscopy or FE - SEM) |
| Solvent | Tetrahydrofuran (THF) |
| Method | Peptide dissolved in solvent at final conc. 30mg/ml by heating at 40 °C. Self assembled structure formed at room temperature. |
| Conc | 30mg/ml |
| Temperature | 25°C |
| Year | 2013 |
| Self assembly | Yes |
| Type of Self assembly | Left handed Nanoribbon |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanoribbon | |
| 125 | |
| aa | |
| N[C@H](C)C(=O)N[C@H](C)C=O | |
| Primary information | |
| SAPdb ID | 1352, |
| PMID | 23915244 |
| Peptide Name | D-Ala-D-Ala |
| Peptide sequence | aa |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | FE - SEM (Field Emission Scanning Electron Microscopy or FE - SEM) |
| Solvent | Water +Tetrahydrofuran (THF) [9:1 and 7:3] |
| Method | Peptide dissolved in solvent at final conc. 30mg/ml by heating at 40 °C. Self assembled structure formed at room temperature. |
| Conc | 30mg/ml |
| Temperature | 25°C |
| Year | 2013 |
| Self assembly | Yes |
| Type of Self assembly | Right handed Nanoribbon |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanoribbon | |
| 125 | |
| aa | |
| N[C@H](C)C(=O)N[C@H](C)CO | |
| Primary information | |
| SAPdb ID | 1353, |
| PMID | 23915244 |
| Peptide Name | D-Ala-D-Ala |
| Peptide sequence | aa |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | FE - SEM (Field Emission Scanning Electron Microscopy or FE - SEM) |
| Solvent | Water +Tetrahydrofuran (THF) [5:5 and 3:7] |
| Method | Peptide dissolved in solvent at final conc. 30mg/ml by heating at 40 °C. Self assembled structure formed at room temperature. |
| Conc | 30mg/ml |
| Temperature | 25°C |
| Year | 2013 |
| Self assembly | Yes |
| Type of Self assembly | Shrank particles |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Others | |
| NA | |
| aa | |
| N[C@H](C)C(=O)N[C@H](C)C=O | |
| Primary information | |
| SAPdb ID | 1354, |
| PMID | 23915244 |
| Peptide Name | D-Ala-D-Ala |
| Peptide sequence | aa |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | FE - SEM (Field Emission Scanning Electron Microscopy or FE - SEM) |
| Solvent | Water +Tetrahydrofuran (THF) [1:9] |
| Method | Peptide dissolved in solvent at final conc. 30mg/ml by heating at 40 °C. Self assembled structure formed at room temperature. |
| Conc | 30mg/ml |
| Temperature | 25°C |
| Year | 2013 |
| Self assembly | Yes |
| Type of Self assembly | Straight belt |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Others | |
| NA | |
| aa | |
| N[C@H](C)C(=O)N[C@H](C)C=O | |
| Primary information | |
| SAPdb ID | 1384, |
| PMID | 24786493 |
| Peptide Name | Fmoc-AA |
| Peptide sequence | AA |
| N-Terminal Modification | Fmoc(fluorenylmethoxycarbonyl) |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide derivative |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | 1 equiv of 0.5 M NaOH + 1 equiv of 0.1 M HCl |
| Method | To the peptide solution (5mg/ml) 1 equiv of 0.5 M NaOH was added in order to deprotonate and dissolve the molecules. This mixture was vortex mixed and sonicateed followed by addition of a small volume of 1 equiv of 0.1 M HCl in a separate vial to reduce the gel inhomogeneity. |
| Conc | 5mg/ml |
| Temperature | pH 3.1 - 3.5 |
| Year | 2014 |
| Self assembly | Yes |
| Type of Self assembly | Hydrogel (flat, ribbon like structures) |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable to hydrolysis | |
| Hydrogel | |
| NA | |
| AA | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1475, |
| PMID | 22651803 |
| Peptide Name | Dipeptide2 |
| Peptide sequence | AA |
| N-Terminal Modification | Napthalene |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | SEM (Scanning Electron Microscopy) and X - Ray Diffraction |
| Solvent | Water + 0.1 M NaOH |
| Method | 25mg of dipeptide was suspended in deionized 5ml water . An equimolar amount of NaOH (0.1 M,aq) was added, and the solution was gently stirred until a clear solution was formed. Glucono-δ- lactone (GdL) was added to the solution and the samples were gently swirled to dissolve the GdL before being left to stand for 24 h without stirring to form gel. |
| Conc | 5mg/ml or 0.5%wt |
| Temperature | Room temperature |
| Incubation Time | 24 hours |
| Year | 2012 |
| Self assembly | Yes |
| Type of Self assembly | Crystal structure |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Others | |
| NA | |
| AA | |
| N[C@@H](Cc1ccc2c(c1)cccc2)C(=O)N[C@@H](C)C=O | |
| Primary information | |
| SAPdb ID | 1482, |
| PMID | 22651803 |
| Peptide Name | Dipeptide11 |
| Peptide sequence | AA |
| N-Terminal Modification | Napthalene |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | SEM (Scanning Electron Microscopy) and X - Ray Diffraction |
| Solvent | Water + 0.1 M NaOH |
| Method | 25mg of dipeptide was suspended in deionized 5ml water . An equimolar amount of NaOH (0.1 M,aq) was added, and the solution was gently stirred until a clear solution was formed. Glucono-δ- lactone (GdL) was added to the solution and the samples were gently swirled to dissolve the GdL before being left to stand for 24 h without stirring to form gel. |
| Conc | 5mg/ml or 0.5%wt |
| Temperature | Room temperature |
| Incubation Time | 24 hours |
| Year | 2012 |
| Self assembly | Yes |
| Type of Self assembly | Transparent or clear gel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Hydrogel | |
| NA | |
| AA | |
| N[C@@H](Cc1ccc2c(c1)cccc2)C(=O)N[C@@H](C)C=O | |
| Primary information | |
| SAPdb ID | 1511, |
| PMID | 20461244 |
| Peptide Name | Peptide-III |
| Peptide sequence | AA |
| N-Terminal Modification | Anthracene |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Conjugate |
| Conjugate partner | Anthracene |
| Solvent | Water + NaOH + 3.75 mg/ml GdL(glucono-delta-lactone) |
| Method | Addition of NaOH to an aqueous suspension of the dipeptide followed by addition of 3.75 mg mL 1 of GdL resulted in the formation of a transparent gel |
| Conc | 2.2mM |
| Incubation Time | 15 minutes |
| Year | 2010 |
| Self assembly | No |
| Type of Self assembly | No hydrogel formation or unstable hydrogel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Hydrogel | |
| NA | |
| AA | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1514, |
| PMID | 20695592 |
| Peptide Name | Dipeptide 2 |
| Peptide sequence | AA |
| N-Terminal Modification | Napthalene |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Water + NaOH + 8.75 mg/ml GdL(glucono-delta-lactone) |
| Method | Dipeptide solution mixed with equimolar solution of 0.1M NaOH followd by gentle stirring for 30 minutes to obtain clear solution. Then to lower the pH GdL is added and kept it undisturbed for 24 hours to get gel. |
| Conc | 0.5%wt |
| Temperature | 3.4 +/- 0.2. |
| Temperature | Room temperature |
| Incubation Time | > 24 hours |
| Year | 2010 |
| Self assembly | Yes |
| Type of Self assembly | Transparent gel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable | |
| Hydrogel | |
| NA | |
| AA | |
| N[C@@H](Cc1ccc2c(c1)cccc2)C(=O)N[C@@H](C)C=O | |
| Primary information | |
| SAPdb ID | 1520, |
| PMID | 20695592 |
| Peptide Name | Dipeptide 8 |
| Peptide sequence | AA |
| N-Terminal Modification | Bromo-Napthalene or napthalene derivative |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Water + NaOH + 8.75 mg/ml GdL(glucono-delta-lactone) |
| Method | Dipeptide solution mixed with equimolar solution of 0.1M NaOH followd by gentle stirring for 30 minutes to obtain clear solution. Then to lower the pH GdL is added and kept it undisturbed for 24 hours to get gel. |
| Conc | 0.5%wt |
| Temperature | 3.4 +/- 0.2. |
| Temperature | Room temperature |
| Incubation Time | > 24 hours |
| Year | 2010 |
| Self assembly | Yes |
| Type of Self assembly | Transparent gel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable | |
| Hydrogel | |
| NA | |
| AA | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1526, |
| PMID | 20695592 |
| Peptide Name | Dipeptide 14 |
| Peptide sequence | AA |
| N-Terminal Modification | Cyano-Napthalene or napthalene derivative |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Water + NaOH + 8.75 mg/ml GdL(glucono-delta-lactone) |
| Method | Dipeptide solution mixed with equimolar solution of 0.1M NaOH followd by gentle stirring for 30 minutes to obtain clear solution. Then to lower the pH GdL is added and kept it undisturbed for 24 hours to get gel. |
| Conc | 0.5%wt |
| Temperature | 3.4 +/- 0.2. |
| Temperature | Room temperature |
| Incubation Time | > 24 hours |
| Year | 2010 |
| Self assembly | Yes |
| Type of Self assembly | Turbid gel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Hydrogel | |
| NA | |
| AA | |
| N.A. | |