Detailed description of 4539 ID |
| Primary information | |||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| AHTPDB ID | 4539 | ||||||||||||
| PMID | 20941517 | ||||||||||||
| YEAR | 2011 | ||||||||||||
| SEQUENCE | FR | ||||||||||||
| LENGTH | 2 | ||||||||||||
| MOL WT | 321.38 | ||||||||||||
| IC50 | ND | ||||||||||||
| pIC50 | 3.04 | ||||||||||||
| SOURCE | ND | ||||||||||||
| TESTED ON | ND | ||||||||||||
| PURIFICATION | ND | ||||||||||||
| ASSAY | ND | ||||||||||||
| BITTERNESS | ND | ||||||||||||
| ISOELECTRIC POINT | 9.75 | ||||||||||||
| SYSTOLIC BP DECREASE | ND | ||||||||||||
| Secondary information | |||||||||||||
| Properties | Physico-Chemical details | ||||||||||||
| STRUCTURE |
| ||||||||||||
| DSSP states | CC | ||||||||||||
| SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCN=C)C(=O)O | ||||||||||||
| External Links to PDB, Swiss-Prot and IEDB | |||||||||||||
| |||||||||||||
| Reference Informaiton | |||||||||||||
| ARTICLE/REFERENCE | QSAR study on angiotensin-converting enzyme inhibitor oligopeptides based on a novel set of sequence information descriptors. | ||||||||||||
| AUTHORS/PRIMARY REFERENCE | Wang X1, Wang J, Lin Y, Ding Y, Wang Y, Cheng X, Lin Z. | ||||||||||||
| JOURNAL/EXTRA LINKS | J Mol Model. 2011 Jul;17(7):1599-606. | ||||||||||||