Detailed description of 4583 ID |
| Primary information | |||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| AHTPDB ID | 4583 | ||||||||||||
| PMID | 20941517 | ||||||||||||
| YEAR | 2011 | ||||||||||||
| SEQUENCE | PGI | ||||||||||||
| LENGTH | 3 | ||||||||||||
| MOL WT | 285.34 | ||||||||||||
| IC50 | ND | ||||||||||||
| pIC50 | 2.23 | ||||||||||||
| SOURCE | ND | ||||||||||||
| TESTED ON | ND | ||||||||||||
| PURIFICATION | ND | ||||||||||||
| ASSAY | ND | ||||||||||||
| BITTERNESS | ND | ||||||||||||
| ISOELECTRIC POINT | 5.96 | ||||||||||||
| SYSTOLIC BP DECREASE | ND | ||||||||||||
| Secondary information | |||||||||||||
| Properties | Physico-Chemical details | ||||||||||||
| STRUCTURE |
| ||||||||||||
| DSSP states | CCC | ||||||||||||
| SMILES | N1CCC[C@H]1C(=O)NCC(=O)N[C@@H]([C@@H](C)CC)C(=O)O | ||||||||||||
| External Links to PDB, Swiss-Prot and IEDB | |||||||||||||
| |||||||||||||
| Reference Informaiton | |||||||||||||
| ARTICLE/REFERENCE | QSAR study on angiotensin-converting enzyme inhibitor oligopeptides based on a novel set of sequence information descriptors. | ||||||||||||
| AUTHORS/PRIMARY REFERENCE | Wang X1, Wang J, Lin Y, Ding Y, Wang Y, Cheng X, Lin Z. | ||||||||||||
| JOURNAL/EXTRA LINKS | J Mol Model. 2011 Jul;17(7):1599-606. | ||||||||||||