Welcome to Sequence Card of Peptide
Details of SAPdb entry with Sequence KK |
| Primary information | |
|---|---|
| SAPdb ID | 1226, |
| PMID | 25384556 |
| Peptide Name | Compound A |
| Peptide sequence | KK |
| N-Terminal Modification | Acetylation |
| C-Terminal Modification | Amidation |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Conjugate |
| Conjugate partner | Camptothecin (CPT) -conjugated |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Phosphate buffer saline |
| Method | Samples were prepared by dissolving CPT–dipeptides in PBS (10 mm), then diluting to 1 mm after 24 h. |
| Conc | 1mM |
| Temperature | 7.4 |
| Temperature | 37°C |
| Incubation Time | 72 hours |
| Year | 2015 |
| Self assembly | Yes |
| Type of Self assembly | Coiled ribbon and tapes |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanoribbon, Nanotape | |
| NA | |
| KK | |
| CC(=O)N[C@@H](CCCC[NH3])C(=O)N[C@@H](CCCC[NH3])C(=O)N | |
| Primary information | |
| SAPdb ID | 1227, |
| PMID | 25384556 |
| Peptide Name | Compound A |
| Peptide sequence | KK |
| N-Terminal Modification | Acetylation |
| C-Terminal Modification | Amidation |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Conjugate |
| Conjugate partner | Camptothecin (CPT) -conjugated |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Phosphate buffer saline |
| Method | Samples were prepared by dissolving CPT–dipeptides in PBS (10 mm), then diluting to 1 mm after 24 h. |
| Conc | Preincubation at 10mM for 24 h, 1mM for rest 48 hours |
| Temperature | 7.4 |
| Temperature | 37°C |
| Incubation Time | 72 hours |
| Year | 2015 |
| Self assembly | Yes |
| Type of Self assembly | Nanotubes |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable at 37°C | |
| Nanotube | |
| 100 | |
| KK | |
| CC(=O)N[C@@H](CCCC[NH3])C(=O)N[C@@H](CCCC[NH3])C(=O)N | |
| Primary information | |
| SAPdb ID | 1228, |
| PMID | 25384556 |
| Peptide Name | Compound B |
| Peptide sequence | KK |
| N-Terminal Modification | Free |
| C-Terminal Modification | Amidation |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Conjugate |
| Conjugate partner | Camptothecin (CPT) -conjugated |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Water or Phosphate buffer saline |
| Method | Samples were prepared by dissolving CPT–dipeptides in PBS (10 mm), then diluting to 1 mm after 24 h. |
| Conc | Preincubation at 10mM for 24 h, 1mM for rest 48 hours |
| Temperature | 7.4 |
| Temperature | 37°C |
| Incubation Time | 72 hours |
| Year | 2015 |
| Self assembly | Yes |
| Type of Self assembly | Nanotubes |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable at 37°C | |
| Nanotube | |
| 100 | |
| KK | |
| N[C@@H](CCCC[NH3])C(=O)N[C@@H](CCCC[NH3])C(=O)N | |
| Primary information | |
| SAPdb ID | 1261, |
| PMID | 19852501 |
| Peptide Name | A or AcKK(NDI)-NH2 |
| Peptide sequence | KK |
| N-Terminal Modification | Acetylation |
| C-Terminal Modification | Amidation and NDI |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Conjugate |
| Conjugate partner | NDI : 1,4,5,8-naphthalenetetracarboxylic acid diimide |
| Technique | TEM (Transmission Electron Microscopy), AFM (Atomic Force Microscopy) |
| Solvent | Water |
| Method | Peptide dissolved in water. 10 ul of peptide solution at conc 250 μM incubated atleast for 2 hours at mica surface. |
| Conc | 250 μM |
| Temperature | Room temperature |
| Incubation Time | > 2 hours |
| Year | 2009 |
| Self assembly | Yes |
| Type of Self assembly | Helical Nanofibres |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanofibers | |
| 10 | |
| KK | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1262, |
| PMID | 19852501 |
| Peptide Name | B or AcK(NDI)K-NH2 |
| Peptide sequence | KK |
| N-Terminal Modification | Acetylation |
| C-Terminal Modification | Amidation |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Conjugate |
| Conjugate partner | NDI : 1,4,5,8-naphthalenetetracarboxylic acid diimide |
| Technique | TEM (Transmission Electron Microscopy), AFM (Atomic Force Microscopy) |
| Solvent | Water |
| Method | Peptide dissolved in water. 10 ul of peptide solution at conc 250 μM incubated atleast for 2 hours at mica surface. |
| Conc | 250 μM |
| Temperature | Room temperature |
| Incubation Time | > 2 hours |
| Year | 2009 |
| Self assembly | Yes |
| Type of Self assembly | Flattened, twisted Nanoribbons |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanoribbon | |
| 16 | |
| KK | |
| CC(=O)N[C@@H](CCCC[NH3])C(=O)N[C@@H](CCCC[NH3])C(=O)N | |
| Primary information | |
| SAPdb ID | 1263, |
| PMID | 19852501 |
| Peptide Name | C or A or NH2-KK(NDI)-NH2 |
| Peptide sequence | KK |
| N-Terminal Modification | Free |
| C-Terminal Modification | Amidation and NDI |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Conjugate |
| Conjugate partner | NDI : 1,4,5,8-naphthalenetetracarboxylic acid diimide |
| Technique | TEM (Transmission Electron Microscopy), AFM (Atomic Force Microscopy) |
| Solvent | Water |
| Method | Peptide dissolved in water. 10 ul of peptide solution at conc 250 μM incubated atleast for 2 hours at mica surface. |
| Conc | 250 μM |
| Temperature | Room temperature |
| Incubation Time | > 2 hours |
| Year | 2009 |
| Self assembly | Yes |
| Type of Self assembly | Nanostructures |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanoparticle | |
| NA | |
| KK | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1264, |
| PMID | 19852501 |
| Peptide Name | C or A or NH2-KK(NDI)-NH2 |
| Peptide sequence | KK |
| N-Terminal Modification | Free |
| C-Terminal Modification | Amidation and NDI |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Conjugate |
| Conjugate partner | NDI : 1,4,5,8-naphthalenetetracarboxylic acid diimide |
| Technique | TEM (Transmission Electron Microscopy), AFM (Atomic Force Microscopy) |
| Solvent | Water |
| Method | Peptide dissolved in water. 10 ul of peptide solution at conc 25nM incubated atleast for 2 hours at mica surface. |
| Conc | 25nM |
| Temperature | Room temperature |
| Incubation Time | > 2 hours |
| Year | 2009 |
| Self assembly | Yes |
| Type of Self assembly | Nanofibers |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanofibers | |
| NA | |
| KK | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1297, |
| PMID | 23034819 |
| Peptide Name | Dipeptide A or (Ac-KK(NDI)-NH2) |
| Peptide sequence | KK |
| N-Terminal Modification | Acetylation |
| C-Terminal Modification | Amidation and NDI |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Conjugate |
| Conjugate partner | NDI : 1,4,5,8-naphthalenetetracarboxylic acid diimide |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Water |
| Year | 2012 |
| Self assembly | Yes |
| Type of Self assembly | Helical Nanofibers |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanofibers | |
| 10 | |
| KK | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1298, |
| PMID | 23034819 |
| Peptide Name | DipeptideB or (Ac-K(NDI)K-NH2) |
| Peptide sequence | KK |
| N-Terminal Modification | Acetylation |
| C-Terminal Modification | Amidation and NDI |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Conjugate |
| Conjugate partner | NDI : 1,4,5,8-naphthalenetetracarboxylic acid diimide |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Water |
| Year | 2012 |
| Self assembly | Yes |
| Type of Self assembly | Flattened, twisted Nanoribbons |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanoribbon | |
| 45 | |
| KK | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1299, |
| PMID | 23034819 |
| Peptide Name | Dipeptide C or (H2N-K(NDI)K-NH2) |
| Peptide sequence | KK |
| N-Terminal Modification | Free |
| C-Terminal Modification | Amidation |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Conjugate |
| Conjugate partner | NDI : 1,4,5,8-naphthalenetetracarboxylic acid diimide |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Water |
| Year | 2012 |
| Self assembly | No |
| Type of Self assembly | No self assembled structure |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| None | |
| NA | |
| KK | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1300, |
| PMID | 23034819 |
| Peptide Name | Fmoc-KK(NDI)-NH2 |
| Peptide sequence | KK |
| N-Terminal Modification | Fmoc(fluorenylmethoxycarbonyl) |
| C-Terminal Modification | Amidation and NDI |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Conjugate |
| Conjugate partner | NDI : 1,4,5,8-naphthalenetetracarboxylic acid diimide |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Water |
| Year | 2012 |
| Self assembly | Yes |
| Type of Self assembly | Nanobelt |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Others | |
| 8 | |
| KK | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1406, |
| PMID | 25377526 |
| Peptide Name | Di- lysine or KK |
| Peptide sequence | KK |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Mixture |
| Conjugate partner | H2TPPS[tetrakis(4-sulfonatophenyl)porphine] |
| Technique | SEM (Scanning Electron Microscopy), TEM (Transmission Electron Microscopy) and AFM (Atomic Force Microscopy) |
| Solvent | Water + Tetraphenylporphyrin |
| Method | Aqueous solution of H2TPPS (1 mM), HCl solution (1 M) and KK solution (0.1 M) mixed. The final concentration of H2TPPS and KK is 0.1 and 1 mM, respectively,and thel pH of final solution is 1.9. |
| Conc | 0.1M |
| Temperature | pH 1.9 or < 2.0 |
| Temperature | Room temperature |
| Year | 2014 |
| Self assembly | Yes |
| Type of Self assembly | Fibril bundles |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| Co-assembly with H2TPPS[tetrakis(4-sulfonatophenyl)porphine] | |
| Photostable | |
| Nanofibers | |
| NA | |
| KK | |
| N[C@@H](CCCC[NH3])C(=O)N[C@@H](CCCC[NH3])C=O | |
| Primary information | |
| SAPdb ID | 1605, |
| PMID | 20467689 |
| Peptide Name | Fmoc-KK(NDI) |
| Peptide sequence | KK |
| N-Terminal Modification | Fmoc(fluorenylmethoxycarbonyl) |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Conjugate |
| Conjugate partner | NDI ((1,4,5,8-naphthalenetetracarboxylic acid diimide)) |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Water |
| Method | 3mg of freeze-dried Fmoc-KK(NDI) added to water (200 μl) and the mixture was sonicated until all the solid was dissolved. The self-supporting hydrogel was usually formed within 6 h at Room temperature. |
| Conc | 1.5 wt% |
| Temperature | Room temperature |
| Year | 2010 |
| Self assembly | Yes |
| Type of Self assembly | Hydrogel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable at upto 75°C | |
| Hydrogel | |
| NA | |
| KK | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1606, |
| PMID | 20467689 |
| Peptide Name | Fmoc-KK(NDI) |
| Peptide sequence | KK |
| N-Terminal Modification | Fmoc(fluorenylmethoxycarbonyl) |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Conjugate |
| Conjugate partner | NDI ((1,4,5,8-naphthalenetetracarboxylic acid diimide)) |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Water |
| Method | 3mg of freeze-dried Fmoc-KK(NDI) added to water (200 μl) and the mixture was sonicated until all the solid was dissolved and further diluted with Distilled water . The self-supporting hydrogel was usually formed within 6 h at Room temperature. |
| Conc | 250μM |
| Temperature | Room temperature |
| Year | 2010 |
| Self assembly | Yes |
| Type of Self assembly | Nanobelt |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable at upto 75°C | |
| Others | |
| 8 | |
| KK | |
| N.A. | |