| Field | Sense | Antisense |
| siRNA chemical modification | Hexitol nucleic acid | 2-Aminopropyl |
| siRNA modification types | 1 | 1 |
| Overall number of modifications | 4 | 1 |
| Position of modifications | 2,8,14,17 | 1 |
| Modification on sugar or base or phosphate | Sugar | Sugar |
| SMILES (Click to view structure & nomenclature) |
OCC1OCCCC1O |
NCCCOC1C(O)C(CO)OC1N1C=NC2=C1C=C(F)C=C2F |
| siRNA Sequence | GACGUAAACGGCCACAAGUUC | ACUUGUGGCCGUUUACGUCGCU |
| siRNA length base-pair | 21 | 22 |
| siRNA name in paper | GS2332 | JH1001 |
| Biological activity | 59.3 percent target mRNA inhibition | |
| Experiment used to check activity | Luciferase reporter assay | |
| Melting temperature (oC) | NA | |
| Target gene | EGFP gene | |
| siRNA concentration | 10 nM | |
| Cell or Organism used | HeLa cells | |
| Transfection method | Interfer (Polypus -Transfection) | |
| Duration after transfection | 72 Hours | |
| Article title | A large-scale chemical modification screen identifies design rules to generate siRNAs with high activity, high stability and low toxicity |
|
| Reference | 19282453 | |