Field | Sense | Antisense |
siRNA chemical modification | Locked nucleic acid | 2-Aminopropyl |
siRNA modification types | 1 | 1 |
Overall number of modifications | 6 | 1 |
Position of modifications | 3,8,13,15,20,21 | 1 |
Modification on sugar or base or phosphate | Sugar | Sugar |
SMILES (Click to view structure & nomenclature) |
OCC12COC(CO1)C2O |
NCCCOC1C(O)C(CO)OC1N1C=NC2=C1C=C(F)C=C2F |
siRNA Sequence | GACGUAAACGGCCACAAGUTCU | ACUUGUGGCCGUUUACGUCGCU |
siRNA length base-pair | 22 | 22 |
siRNA name in paper | W181 | JH1001 |
Biological activity | 12.8 percent target mRNA inhibition | |
Experiment used to check activity | Luciferase reporter assay | |
Melting temperature (oC) | NA | |
Target gene | EGFP gene | |
siRNA concentration | 10 nM | |
Cell or Organism used | HeLa cells | |
Transfection method | Interfer (Polypus -Transfection) | |
Duration after transfection | 72 Hours | |
Article title | A large-scale chemical modification screen identifies design rules to generate siRNAs with high activity, high stability and low toxicity |
|
Reference | 19282453 |