| Field | Sense | Antisense |
| siRNA chemical modification | Dihydrouridine | Pseudouridine |
| siRNA modification types | 1 | 1 |
| Overall number of modifications | 1 | 1 |
| Position of modifications | 19 | 19 |
| Modification on sugar or base or phosphate | Base | Base |
| SMILES (Click to view structure & nomenclature) |
O=C1CCNC(=O)N1 |
OCC1OC(C(O)C1O)C1=CNC(=O)NC1=O |
| siRNA Sequence | ACAUGAAGCAGCACGACUUTT | AAGUCGUGCUGCUUCAUGUTT |
| siRNA length base-pair | 21 | 21 |
| siRNA name in paper | sD19 | sψ19 |
| Biological activity | 90 percent target mRNA inhibition | |
| Experiment used to check activity | Dual fluorescence assay | |
| Melting temperature (oC) | 82.7 | |
| Target gene | EGFP gene | |
| siRNA concentration | 1 nM | |
| Cell or Organism used | HeLa cells | |
| Transfection method | Lipofectamine 2000 | |
| Duration after transfection | 36 Hours | |
| Article title | Effect of base modifications on structure, thermodynamic stability, and gene silencing activity of short interfering RNA |
|
| Reference | 17585051 | |