| Field | Sense | Antisense |
| siRNA chemical modification | 0 | 2-Thiouridine |
| siRNA modification types | 0 | 2 |
| Overall number of modifications | 0 | 2 |
| Position of modifications | 0 | 18, 20 |
| Modification on sugar or base or phosphate | 0 | Base |
| SMILES (Click to view structure & nomenclature) |
- |
OCC1OC(C(O)C1O)N1C=CC(=O)NC1=S |
| siRNA Sequence | AUACAGGCAGCAGUAACUUUTT | AAAGUUACUGCUGCCUGUAUTT |
| siRNA length base-pair | 22 | 22 |
| siRNA name in paper | sSYM | a s2U17 19 |
| Biological activity | 76 percent target mRNA inhibition | |
| Experiment used to check activity | Dual fluorescence assay | |
| Melting temperature (oC) | NA | |
| Target gene | EGFP gene | |
| siRNA concentration | 1 nM | |
| Cell or Organism used | HeLa cells | |
| Transfection method | Lipofectamine 2000 | |
| Duration after transfection | 36 Hours | |
| Article title | Effect of base modifications on structure, thermodynamic stability, and gene silencing activity of short interfering RNA |
|
| Reference | 17585051 | |